Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-15 00:32:42 UTC
Update Date2025-10-07 16:05:19 UTC
Metabolite IDMMDBc0007313
Metabolite Identification
Common NameErgoflavin
DescriptionErgoflavin is a flavonoid, a class of compounds known for their diverse biological activities and roles in plant metabolism. This metabolite has garnered attention in biomedical literature due to its significant bioactive properties. Ergoflavin has been isolated from an endophytic fungus associated with the Indian medicinal plant Mimosops elengi (bakul), highlighting its ecological and pharmacological relevance (PMID:19479845 ). Studies have demonstrated its anti-inflammatory and anticancer activities, suggesting potential therapeutic applications (PMID:19479845 ). Additionally, ergoflavin is part of a broader category of bioactive compounds, which includes various other metabolites like pestacin, taxol, and camptothecin, indicating its importance in natural product chemistry (PMID:33671354 ). The structural elucidation of ergoflavin has been documented, providing insights into its chemical constitution and potential mechanisms of action (PMID:14342839 ). Overall, ergoflavin exemplifies the intersection of chemistry and biology, showcasing the potential of natural compounds in drug discovery and development.
Structure
SynonymsNot Available
Molecular FormulaC30H26O14
Average Mass610.524
Monoisotopic Mass610.132255517
IUPAC Name7,10,14-trihydroxy-13-methyl-6-{7,10,14-trihydroxy-13-methyl-9,15-dioxo-2,16-dioxatetracyclo[9.3.2.0¹,¹⁰.0³,⁸]hexadeca-3,5,7-trien-6-yl}-2,16-dioxatetracyclo[9.3.2.0¹,¹⁰.0³,⁸]hexadeca-3,5,7-triene-9,15-dione
Traditional Name7,10,14-trihydroxy-13-methyl-6-{7,10,14-trihydroxy-13-methyl-9,15-dioxo-2,16-dioxatetracyclo[9.3.2.0¹,¹⁰.0³,⁸]hexadeca-3,5,7-trien-6-yl}-2,16-dioxatetracyclo[9.3.2.0¹,¹⁰.0³,⁸]hexadeca-3,5,7-triene-9,15-dione
CAS Registry NumberNot Available
SMILES
CC1CC2OC(=O)C3(OC4=CC=C(C(O)=C4C(=O)C23O)C2=CC=C3OC45C(O)C(C)CC(OC4=O)C5(O)C(=O)C3=C2O)C1O
InChI Identifier
InChI=1S/C30H26O14/c1-9-7-15-27(39)23(35)17-13(43-29(27,21(9)33)25(37)41-15)5-3-11(19(17)31)12-4-6-14-18(20(12)32)24(36)28(40)16-8-10(2)22(34)30(28,44-14)26(38)42-16/h3-6,9-10,15-16,21-22,31-34,39-40H,7-8H2,1-2H3
InChI KeyRAVDMGKYJQVXDU-UHFFFAOYSA-N