Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:35:46 UTC
Update Date2025-10-07 16:05:19 UTC
Metabolite IDMMDBc0007398
Metabolite Identification
Common NameMiyakamide B1
DescriptionMiyakamide B1 is a peptide-like metabolite belonging to the class of N-acylated amino acids. Its chemical structure is characterized as N-acetyl-L-tyrosyl-N-methyl-L-phenylalanyl-(alphaZ)-alpha,beta-didehydrotryptamine, indicating a complex arrangement of amino acid residues and modifications that contribute to its biological activity. This compound, along with its E isomer Miyakamide B2, has garnered attention for its potential biological implications, although specific biological functions remain to be fully elucidated. The unique structural features of Miyakamide B1 suggest that it may interact with various biological targets, potentially influencing metabolic pathways or cellular processes. Further research into Miyakamide B1 could provide insights into its role in natural products and its potential applications in pharmacology or biotechnology. Understanding the synthesis and function of such metabolites is crucial for advancing knowledge in the field of medicinal chemistry and exploring new therapeutic avenues. (PMID:12546416 )
Structure
SynonymsNot Available
Molecular FormulaC31H32N4O4
Average Mass524.621
Monoisotopic Mass524.242355526
IUPAC Name(2S)-2-[(2S)-2-[(1-hydroxyethylidene)amino]-3-(4-hydroxyphenyl)-N-methylpropanamido]-N-[(Z)-2-(1H-indol-3-yl)ethenyl]-3-phenylpropanimidic acid
Traditional Name(2S)-2-[(2S)-2-[(1-hydroxyethylidene)amino]-3-(4-hydroxyphenyl)-N-methylpropanamido]-N-[(Z)-2-(1H-indol-3-yl)ethenyl]-3-phenylpropanimidic acid
CAS Registry NumberNot Available
SMILES
[H]\C(N=C(O)[C@]([H])(CC1=CC=CC=C1)N(C)C(=O)[C@]([H])(CC1=CC=C(O)C=C1)N=C(C)O)=C(/[H])C1=CNC2=CC=CC=C12
InChI Identifier
InChI=1S/C31H32N4O4/c1-21(36)34-28(18-23-12-14-25(37)15-13-23)31(39)35(2)29(19-22-8-4-3-5-9-22)30(38)32-17-16-24-20-33-27-11-7-6-10-26(24)27/h3-17,20,28-29,33,37H,18-19H2,1-2H3,(H,32,38)(H,34,36)/b17-16-/t28-,29-/m0/s1
InChI KeyFDKBLSNCAOHWNC-ANVHOORDSA-N