Xenobiotic
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:37:23 UTC
Update Date2025-10-07 16:05:19 UTC
Metabolite IDMMDBc0007450
Metabolite Identification
Common NameAromadendrene
DescriptionAromadendrene is a sesquiterpene, a class of terpenoids characterized by their 15-carbon skeleton. This compound plays a significant role in plant metabolism and ecological interactions. It has been identified as a metabolite involved in the synthesis of various sesquiterpenes, contributing to the defense mechanisms of plants such as chrysanthemums against aphid infestations (PMID:40968705 ). Aromadendrene is also notable for its presence across multiple species, aiding in their identification and classification through principal component analysis (PCA) (PMID:40825175 ). In essential oils (EOs), aromadendrene is among the most prevalent compounds, showcasing its importance in the volatile profiles of various plants (PMID:40733254 ). Furthermore, it has demonstrated strong bioactive properties, exhibiting a high binding affinity to xanthine oxidase (XO), which suggests potential therapeutic applications (PMID:40540880 ). Its abundance in ripe fruits indicates a role in attracting pollinators, such as bats, and may signify fruit ripening (PMID:39866609 ). Overall, aromadendrene is a critical compound in both ecological and industrial contexts, contributing to the aromatic qualities of essential oils and the biological interactions of plants.
Structure
Synonyms
ValueSource
AromadendreneMeSH
Molecular FormulaC15H24
Average Mass204.357
Monoisotopic Mass204.187800773
IUPAC Name(1aS,1bR,2R,4aR,7aR)-1,1,2-trimethyl-5-methylidene-decahydro-1H-cyclopropa[e]azulene
Traditional Name(1aS,1bR,2R,4aR,7aR)-1,1,2-trimethyl-5-methylidene-octahydro-1aH-cyclopropa[e]azulene
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCC(=C)[C@]3([H])CC[C@@]([H])(C)[C@@]3([H])[C@]1([H])C2(C)C
InChI Identifier
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10-14H,1,5-8H2,2-4H3/t10-,11+,12-,13-,14-/m1/s1
InChI KeyITYNGVSTWVVPIC-XVIXHAIJSA-N