Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:37:43 UTC
Update Date2025-10-07 16:05:20 UTC
Metabolite IDMMDBc0007461
Metabolite Identification
Common NameHydroxymethylanserinone B
DescriptionHydroxymethylanserinone B is a secondary metabolite belonging to the class of alkaloids. It has been identified as a minor constituent in certain biological samples, alongside deoxyanserinone B, although it has not been completely purified, indicating that further studies are needed to elucidate its structure and properties (PMID:15043411 ). Alkaloids, including hydroxymethylanserinone B, are known for their diverse biological activities, which may include effects on neurotransmission and potential therapeutic applications. The presence of hydroxymethylanserinone B in various biological matrices suggests it may play a role in the metabolic pathways of the organisms from which it is derived, although its specific biological functions remain to be fully characterized. Further research is warranted to explore its pharmacological potential and to better understand its biosynthetic origins and ecological roles.
Structure
SynonymsNot Available
Molecular FormulaC12H16O5
Average Mass240.255
Monoisotopic Mass240.099773615
IUPAC Name2-(hydroxymethyl)-5-(2-hydroxypropyl)-3-methoxy-6-methylcyclohexa-2,5-diene-1,4-dione
Traditional Name2-(hydroxymethyl)-5-(2-hydroxypropyl)-3-methoxy-6-methylcyclohexa-2,5-diene-1,4-dione
CAS Registry NumberNot Available
SMILES
COC1=C(CO)C(=O)C(C)=C(CC(C)O)C1=O
InChI Identifier
InChI=1S/C12H16O5/c1-6(14)4-8-7(2)10(15)9(5-13)12(17-3)11(8)16/h6,13-14H,4-5H2,1-3H3
InChI KeyHIQLTIKZYHQJCA-UHFFFAOYSA-N