Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:39:32 UTC
Update Date2025-10-07 16:05:20 UTC
Metabolite IDMMDBc0007485
Metabolite Identification
Common NameDehydroaustin
DescriptionDehydroaustin is a meroterpenoid, a chemical class that combines terpenoid and non-terpenoid components. This compound has been identified as a metabolite produced by various fungi, including the algicolous fungus Penicillium sp. and the mangrove endophytic fungus Aspergillus sp. (PMID:38977253 , PMID:28467349 ). Dehydroaustin has garnered attention due to its biological activities, particularly its insecticidal properties; it has been shown to exhibit toxicity to insects, with an LC(50) value of 2.9 ppm, highlighting its potential as a natural insecticide (PMID:18293447 ). Additionally, dehydroaustin is often found alongside other related compounds, such as dehydroaustinol and acetoxydehydroaustin, indicating a complex biosynthetic pathway in its production (PMID:21601895 , PMID:20971131 ). The precise mechanisms of its toxicity remain to be elucidated, but its prominence among meroterpenoids suggests significant ecological and pharmacological relevance. Overall, dehydroaustin represents an intriguing subject for further research in both chemistry and biology, particularly in the context of natural product chemistry and the search for environmentally friendly pest control solutions.
Structure
SynonymsNot Available
Molecular FormulaC27H30O9
Average Mass498.528
Monoisotopic Mass498.188982546
IUPAC Name(1R,2S,5S,7S,8S,9R,12S,13S)-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxo-2',6'-dihydro-10,14,17-trioxaspiro[pentacyclo[7.6.1.1^{7,12}.0^{1,12}.0^{2,7}]heptadecane-5,3'-pyran]-8-yl acetate
Traditional Name(1R,2S,5S,7S,8S,9R,12S,13S)-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxo-10,14,17-trioxaspiro[pentacyclo[7.6.1.1^{7,12}.0^{1,12}.0^{2,7}]heptadecane-5,3'-pyran]-8-yl acetate
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C)OC(=O)[C@@]23C(=C)[C@@]4(C)OC(=O)[C@@]12O[C@]1(C(=C)[C@]2(CC[C@@]31C)C=CC(=O)OC2(C)C)[C@@]4([H])OC(C)=O
InChI Identifier
InChI=1S/C27H30O9/c1-13-23(8)18(33-16(4)28)26-14(2)24(10-9-17(29)34-21(24,5)6)12-11-22(26,7)25(13)19(30)32-15(3)27(25,36-26)20(31)35-23/h9-10,15,18H,1-2,11-12H2,3-8H3/t15-,18-,22-,23+,24+,25+,26+,27-/m0/s1
InChI KeyUMCNDSVRNDMSEX-DVMWOTGCSA-N