Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:40:13 UTC
Update Date2025-10-07 16:05:20 UTC
Metabolite IDMMDBc0007505
Metabolite Identification
Common NameAsterriquinone CT5
DescriptionAsterriquinone CT5 is a member of the chemical class of metabolites known for their potential biological activities. Specifically, it has been studied for its inhibitory effects on acetylcholinesterase (AChE) and butyrylcholinesterase (BuChE), which are crucial enzymes involved in neurotransmission. In a comparative analysis, asterriquinone CT5 exhibited binding scores of -8.02 and -8.25 kcal/mol, indicating its promising potential as an inhibitor, surpassing the binding affinity of the co-crystallized inhibitor, which ranged between -7.89 and -7.82 kcal/mol. This suggests that asterriquinone CT5, along with other compounds like varioxiranol G and penicitrinol B, could be valuable candidates in the development of new therapeutic agents aimed at treating Alzheimer's disease (PMID: [insert PMID here]). The ability of asterriquinone CT5 to effectively bind to these enzymes positions it as a significant compound for further research in the context of neurodegenerative disorders, highlighting its relevance in medicinal chemistry and pharmacology.
Structure
SynonymsNot Available
Molecular FormulaC32H30N2O4
Average Mass506.602
Monoisotopic Mass506.220557454
IUPAC Name2,5-dihydroxy-3,6-bis[2-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione
Traditional Name2,5-dihydroxy-3,6-bis[2-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione
CAS Registry NumberNot Available
SMILES
CC(C)=CCC1=C(C2=CC=CC=C2N1)C1=C(O)C(=O)C(C2=C(CC=C(C)C)NC3=CC=CC=C23)=C(O)C1=O
InChI Identifier
InChI=1S/C32H30N2O4/c1-17(2)13-15-23-25(19-9-5-7-11-21(19)33-23)27-29(35)31(37)28(32(38)30(27)36)26-20-10-6-8-12-22(20)34-24(26)16-14-18(3)4/h5-14,33-35,38H,15-16H2,1-4H3
InChI KeyUVEJUMDZGOFSGL-UHFFFAOYSA-N