Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:49:41 UTC
Update Date2025-10-07 16:05:22 UTC
Metabolite IDMMDBc0007749
Metabolite Identification
Common NameFimsbactin A
DescriptionFimsbactin A is a branched mixed-ligand siderophore belonging to the chemical class of nonribosomal peptides (NRPs). It is produced by the human pathogenic bacterium Acinetobacter baumannii and plays a crucial role in iron acquisition, which is vital for bacterial survival and virulence. The biosynthesis of fimsbactin A involves the putrescine N-monooxygenase (NMO) FbsI, a flavin-dependent enzyme that catalyzes the hydroxylation of putrescine to N-hydroxyputrescine, a key precursor in its assembly (PMID:40581042 ). Recent studies have identified novel fimsbactin analogues, including those with an L-lysine-derived hydroxamate moiety, expanding the understanding of its structural diversity (PMID:40325896 ). Investigations into the biosynthetic pathway have revealed the unusual branching mechanism through various biochemical techniques, including site-directed mutagenesis and molecular dynamics simulations (PMID:39847710 ). Additionally, experimental validation has demonstrated enhanced binding properties of fimsbactin A compared to other siderophores, highlighting its potential applications in biochemistry and medicine (PMID:39178780 ). Overall, fimsbactin A exemplifies the intricate interplay between microbial chemistry and biology, showcasing the importance of NRPs in pathogenicity and iron metabolism.
Structure
SynonymsNot Available
Molecular FormulaC26H30N4O11
Average Mass574.543
Monoisotopic Mass574.191107802
IUPAC Name(2S)-3-(2,3-dihydroxybenzoyloxy)-2-({[(4S)-2-(2,3-dihydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl](hydroxy)methylidene}amino)-N-[4-(N-hydroxyacetamido)butyl]propanimidic acid
Traditional Name(2S)-3-(2,3-dihydroxybenzoyloxy)-2-({[(4S)-2-(2,3-dihydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl](hydroxy)methylidene}amino)-N-[4-(N-hydroxyacetamido)butyl]propanimidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](COC(=O)C1=C(O)C(O)=CC=C1)(N=C(O)[C@]1([H])COC(=N1)C1=C(O)C(O)=CC=C1)C(O)=NCCCCN(O)C(C)=O
InChI Identifier
InChI=1S/C26H30N4O11/c1-14(31)30(39)11-3-2-10-27-23(36)17(13-41-26(38)16-7-5-9-20(33)22(16)35)28-24(37)18-12-40-25(29-18)15-6-4-8-19(32)21(15)34/h4-9,17-18,32-35,39H,2-3,10-13H2,1H3,(H,27,36)(H,28,37)/t17-,18-/m0/s1
InChI KeyGUYAPGULLNBOCI-ROUUACIJSA-N