Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:50:10 UTC
Update Date2025-10-07 16:05:22 UTC
Metabolite IDMMDBc0007761
Metabolite Identification
Common NamePrenisatin
DescriptionPrenisatin is a metabolite belonging to the class of anthraquinones, which are characterized by their polycyclic aromatic structure. This compound has garnered attention in various studies due to its presence in natural extracts, such as the ethyl acetate extract that revealed prenisatin alongside other compounds like chrysophanol and chaetoviridins A and B (PMID:24361402 ). The significance of prenisatin in biological contexts may be linked to its potential pharmacological properties, as many anthraquinones are known for their diverse biological activities, including antimicrobial and anticancer effects. The exploration of prenisatin's properties and its role in biological systems continues to be an area of interest, particularly in understanding how such metabolites contribute to the overall therapeutic potential of natural products. Further research into prenisatin could elucidate its mechanisms of action and potential applications in medicine, enhancing our understanding of its significance in both chemistry and biology.
Structure
SynonymsNot Available
Molecular FormulaC13H13NO2
Average Mass215.252
Monoisotopic Mass215.094628663
IUPAC Name5-(3-methylbut-2-en-1-yl)-2,3-dihydro-1H-indole-2,3-dione
Traditional Name5-(3-methylbut-2-en-1-yl)-1H-indole-2,3-dione
CAS Registry NumberNot Available
SMILES
CC(C)=CCC1=CC2=C(NC(=O)C2=O)C=C1
InChI Identifier
InChI=1S/C13H13NO2/c1-8(2)3-4-9-5-6-11-10(7-9)12(15)13(16)14-11/h3,5-7H,4H2,1-2H3,(H,14,15,16)
InChI KeyDRTSBKDWIKMSCI-UHFFFAOYSA-N