Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:53:09 UTC
Update Date2025-10-07 16:05:23 UTC
Metabolite IDMMDBc0007845
Metabolite Identification
Common NameSpiruchostatin A
DescriptionSpiruchostatin A is a cyclic peptide-based natural product belonging to the chemical class of histone deacetylase inhibitors (HDACi). Derived from Pseudomonas sp., Spiruchostatin A, also known as YM753 and OBP801, exhibits potent inhibition of Class I HDACs, which plays a crucial role in the regulation of gene expression and cancer cell biology. Its antitumor efficacy has been evaluated across various cellular and animal models, demonstrating significant activities such as inducing apoptosis and inhibiting tumor growth (PMID:40082963 ). Spiruchostatin A's mechanism involves epigenetic modifications that alter cancer cell behavior, suggesting its potential as a therapeutic agent against multiple cancers (PMID:40082963 ). Moreover, studies have shown that Spiruchostatin A can synergistically enhance the effects of other treatments, such as FGFR inhibitors, thereby further inhibiting cell growth and promoting apoptosis in high-grade bladder cancer cells (PMID:29207153 ). Although the precise mechanisms of action remain to be fully elucidated, Spiruchostatin A and its analogs are being explored for their promising roles in chemotherapy, particularly for leukemia and other malignancies (PMID:25078973 ). Comprehensive clinical studies are essential to establish its therapeutic potential in oncology (PMID:40082963 ).
Structure
SynonymsNot Available
Molecular FormulaC20H31N3O6S2
Average Mass473.6
Monoisotopic Mass473.165428078
IUPAC Name(9S,15E,20R)-5,8,18,21-tetrahydroxy-20-methyl-6-(propan-2-yl)-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docosa-7,15,18,21-tetraen-3-one
Traditional Name(9S,15E,20R)-5,8,18,21-tetrahydroxy-6-isopropyl-20-methyl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docosa-7,15,18,21-tetraen-3-one
CAS Registry NumberNot Available
SMILES
[H]\C1=C([H])\C2([H])CC(O)=N[C@]([H])(C)C(O)=N[C@]([H])(CSSCC1)C(O)=NC([H])(C(C)C)C([H])(O)CC(=O)O2
InChI Identifier
InChI=1S/C20H31N3O6S2/c1-11(2)18-15(24)9-17(26)29-13-6-4-5-7-30-31-10-14(20(28)23-18)22-19(27)12(3)21-16(25)8-13/h4,6,11-15,18,24H,5,7-10H2,1-3H3,(H,21,25)(H,22,27)(H,23,28)/b6-4-/t12-,13?,14-,15?,18?/m1/s1
InChI KeyXFLBOEMFLGLWFF-GCMQNPFRSA-N