Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:07:07 UTC
Update Date2025-10-07 16:05:26 UTC
Metabolite IDMMDBc0008210
Metabolite Identification
Common Name6-epi-stemphytriol
Description6-epi-stemphytriol is a mycotoxin belonging to the chemical class of perylene quinones. It is a metabolite isolated from the marine endophytic fungus Alternaria alternata, which is associated with an unidentified algal species of the genus Laurencia. This compound, along with other perylene derivatives such as stemphyperylenol and altertoxin I, represents a class of secondary metabolites known for their potential biological activities, including toxicity to various organisms. The structural characteristics and biological implications of 6-epi-stemphytriol contribute to the understanding of fungal metabolites and their ecological roles. Notably, the absolute configuration of 6-epi-stemphytriol, along with other related compounds, was previously undetermined, highlighting the complexity of mycotoxin chemistry. The isolation of 6-epi-stemphytriol emphasizes the diverse chemical arsenal of fungi and their potential impact on marine ecosystems and human health (PMID:25056998 , PMID:19967977 ).
Structure
SynonymsNot Available
Molecular FormulaC20H16O7
Average Mass368.341
Monoisotopic Mass368.089602855
IUPAC Name(1R,12S,12aS,12bR)-1,4,9,12,12a-pentahydroxy-1,2,3,10,11,12,12a,12b-octahydroperylene-3,10-dione
Traditional Name(1R,12S,12aS,12bR)-1,4,9,12,12a-pentahydroxy-2,11,12,12b-tetrahydro-1H-perylene-3,10-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)CC(=O)C2=C(O)C=CC3=C2[C@@]1([H])[C@]1(O)C2=C3C=CC(O)=C2C(=O)C[C@]1([H])O
InChI Identifier
InChI=1S/C20H16O7/c21-9-3-1-7-8-2-4-10(22)17-12(24)6-14(26)20(27,18(8)17)19-13(25)5-11(23)16(9)15(7)19/h1-4,13-14,19,21-22,25-27H,5-6H2/t13-,14+,19+,20-/m1/s1
InChI KeyUDIDBNJPZHIJMU-BBNYVJOESA-N