Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:23:30 UTC
Update Date2025-10-07 16:05:29 UTC
Metabolite IDMMDBc0008578
Metabolite Identification
Common NameSterenin L
DescriptionSterenin L is a secondary metabolite belonging to the class of polyketides, which are known for their diverse biological activities. This compound has garnered attention in the field of medicinal chemistry due to its potential therapeutic applications. In a recent study, Sterenin L demonstrated a significant binding score (40.66) in comparison to other compounds, indicating its potential efficacy as a lead molecule in drug development (PMID:35722152 ). Additionally, Sterenin L was included in molecular dynamics simulations alongside other compounds, such as Pinazaphilone A and Asperphenamate, to assess its interactions and stability as a candidate for further investigation (PMID:35722152 ). The exploration of Sterenin L's properties not only highlights its relevance in pharmacology but also underscores the importance of polyketides in the discovery of novel therapeutic agents. Further studies are warranted to elucidate the specific mechanisms of action and biological pathways influenced by Sterenin L, which may contribute to advancements in drug design and development.
Structure
SynonymsNot Available
Molecular FormulaC27H31NO8
Average Mass497.544
Monoisotopic Mass497.204966962
IUPAC Name2-[6-(2,4-dihydroxy-6-methylbenzoyloxy)-4-hydroxy-5-(3-methylbut-2-en-1-yl)-1-oxo-2,3-dihydro-1H-isoindol-2-yl]-3-methylpentanoic acid
Traditional Name2-[6-(2,4-dihydroxy-6-methylbenzoyloxy)-4-hydroxy-5-(3-methylbut-2-en-1-yl)-1-oxo-3H-isoindol-2-yl]-3-methylpentanoic acid
CAS Registry NumberNot Available
SMILES
CCC(C)C(N1CC2=C(O)C(CC=C(C)C)=C(OC(=O)C3=C(O)C=C(O)C=C3C)C=C2C1=O)C(O)=O
InChI Identifier
InChI=1S/C27H31NO8/c1-6-14(4)23(26(33)34)28-12-19-18(25(28)32)11-21(17(24(19)31)8-7-13(2)3)36-27(35)22-15(5)9-16(29)10-20(22)30/h7,9-11,14,23,29-31H,6,8,12H2,1-5H3,(H,33,34)
InChI KeyJTVABVBUKOFJFR-UHFFFAOYSA-N