Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:30:32 UTC
Update Date2025-10-07 16:05:30 UTC
Metabolite IDMMDBc0008760
Metabolite Identification
Common Name7-epi-8-hydroxyaltertoxin I
Description7-epi-8-hydroxyaltertoxin I is a perylene derivative, a chemical class known for its complex polycyclic aromatic structures. This compound was identified as a metabolite produced by the marine endophytic fungus Alternaria alternata, which was isolated from an unidentified algal species of the genus Laurencia. The isolation of 7-epi-8-hydroxyaltertoxin I, along with other compounds such as 6-epi-stemphytriol, stemphyperylenol, and altertoxin I, highlights the diverse biosynthetic capabilities of this fungal species and its potential ecological roles within marine environments. Perylene derivatives like 7-epi-8-hydroxyaltertoxin I are of interest due to their unique chemical properties and possible biological activities, which may include antimicrobial or cytotoxic effects, although specific biological functions of this compound remain to be fully elucidated. Further research could explore its potential applications in pharmacology or biotechnology, given the increasing interest in natural products derived from marine organisms. (PMID:19967977 )
Structure
SynonymsNot Available
Molecular FormulaC20H16O7
Average Mass368.341
Monoisotopic Mass368.089602855
IUPAC Name(1R,2R,12aS,12bR)-1,2,4,9,12a-pentahydroxy-1,2,3,10,11,12,12a,12b-octahydroperylene-3,10-dione
Traditional Name(1R,2R,12aS,12bR)-1,2,4,9,12a-pentahydroxy-2,11,12,12b-tetrahydro-1H-perylene-3,10-dione
CAS Registry NumberNot Available
SMILES
[H][C@]1(O)C(=O)C2=C(O)C=CC3=C2[C@]([H])([C@@]1([H])O)[C@@]1(O)CCC(=O)C2=C(O)C=CC3=C12
InChI Identifier
InChI=1S/C20H16O7/c21-9-4-2-8-7-1-3-10(22)14-12(7)16(18(25)19(26)17(14)24)20(27)6-5-11(23)13(9)15(8)20/h1-4,16,18-19,21-22,25-27H,5-6H2/t16-,18-,19+,20-/m1/s1
InChI KeyWUCMTTYUUQBEMP-RSPOEFSDSA-N