Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:34:49 UTC
Update Date2025-10-07 16:05:31 UTC
Metabolite IDMMDBc0008886
Metabolite Identification
Common NamePenicillixanthone
DescriptionPenicillixanthone is a xanthone derivative belonging to the chemical class of natural products. This metabolite has been isolated from various fungal species, particularly endophytic fungi such as Talaromyces sp. and marine-derived fungi like Aspergillus fumigatus. Penicillixanthone A, a notable variant, exhibits significant biological activity, including potent cytotoxic effects against cancer cell lines Hep G2 and A549, with IC50 values of 117 nM and 212 nM respectively, and demonstrates antitumor efficacy by inhibiting the PI3K-Akt-mTOR signaling pathway (PMID:38067576 ). Additionally, it has been identified as a dual-coreceptor antagonist with anti-HIV-1 properties, inhibiting both CCR5-tropic and CXCR4-tropic strains of HIV-1 (PMID:29258357 ). The compound has also been characterized in various studies, where it was found alongside other xanthone analogues and metabolites, indicating its relevance in the chemical diversity of fungal secondary metabolites (PMID:34235296 , PMID:32276418 ). Overall, penicillixanthone represents a promising candidate for further pharmacological exploration due to its diverse bioactive properties.
Structure
SynonymsNot Available
Molecular FormulaC16H10Cl2O6
Average Mass369.15
Monoisotopic Mass367.9854434
IUPAC Namemethyl 5,7-dichloro-3,8-dihydroxy-6-methyl-9-oxo-9H-xanthene-1-carboxylate
Traditional Namemethyl 5,7-dichloro-3,8-dihydroxy-6-methyl-9-oxoxanthene-1-carboxylate
CAS Registry NumberNot Available
SMILES
COC(=O)C1=C2C(OC3=C(Cl)C(C)=C(Cl)C(O)=C3C2=O)=CC(O)=C1
InChI Identifier
InChI=1S/C16H10Cl2O6/c1-5-11(17)14(21)10-13(20)9-7(16(22)23-2)3-6(19)4-8(9)24-15(10)12(5)18/h3-4,19,21H,1-2H3
InChI KeyPQPCYOSNIFQULR-UHFFFAOYSA-N