Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:35:31 UTC
Update Date2025-10-07 16:05:31 UTC
Metabolite IDMMDBc0008904
Metabolite Identification
Common NameSequoiamonascin D
DescriptionSequoiamonascin D is a polyketide metabolite described in biomedical literature. It was isolated from the fungus Penicillium sp., alongside other polyketides such as leptosphaerone C, penicillenone, arugosin I, and 9-demethyl FR-901235, as well as known compounds including bacillosporin A, bacillosporin C, sequoiatone A, and sequoiatone B (PMID:18067932 ). Polyketides like sequoiamonascin D are characterized by their diverse structures and biological activities, often exhibiting antimicrobial, antifungal, and cytotoxic properties. The biosynthesis of polyketides typically involves the action of polyketide synthases, which catalyze the condensation of acetyl-CoA and malonyl-CoA units, leading to the formation of complex molecular architectures. The study of sequoiamonascin D and its related compounds can provide insights into the chemical ecology of fungi and their potential applications in drug discovery and development. Understanding the structural features and biological activities of such metabolites is crucial for harnessing their therapeutic potential and elucidating their roles in natural product chemistry.
Structure
SynonymsNot Available
Molecular FormulaC26H33NO7
Average Mass471.55
Monoisotopic Mass471.225702407
IUPAC Namemethyl (9aR)-7-(2-hydroxyethyl)-6,9a-dimethyl-3-[(2R)-2-methyloctanoyl]-2,9-dioxo-2H,7H,9H,9aH-furo[3,2-g]isoquinoline-4-carboxylate
Traditional Namemethyl (9aR)-7-(2-hydroxyethyl)-6,9a-dimethyl-3-[(2R)-2-methyloctanoyl]-2,9-dioxofuro[3,2-g]isoquinoline-4-carboxylate
CAS Registry NumberNot Available
SMILES
[H][C@@](C)(CCCCCC)C(=O)C1=C2C(C(=O)OC)=C3C=C(C)N(CCO)C=C3C(=O)[C@]2(C)OC1=O
InChI Identifier
InChI=1S/C26H33NO7/c1-6-7-8-9-10-15(2)22(29)20-21-19(24(31)33-5)17-13-16(3)27(11-12-28)14-18(17)23(30)26(21,4)34-25(20)32/h13-15,28H,6-12H2,1-5H3/t15-,26-/m1/s1
InChI KeyDUAOHJBNXYSKOY-PVPMGCCUSA-N