Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:45:49 UTC
Update Date2025-10-07 16:05:34 UTC
Metabolite IDMMDBc0009154
Metabolite Identification
Common NameBerkeleyacetal B
DescriptionBerkeleyacetal B is a secondary metabolite belonging to the class of acetal compounds. It was identified in a study focusing on the EtOAc extract of the fungus Penicillium purpurogenum, which revealed a range of structurally diverse compounds, including berkeleyacetal B. The research highlighted the importance of these metabolites in understanding the chemical diversity produced by this fungal species and their potential biological activities. Specifically, the study provided insights into the configuration revisions of berkeleyacetal B alongside other related compounds, suggesting a complex biosynthetic pathway that may have implications for further exploration of their pharmacological potential. The characterization of such metabolites is crucial for elucidating their roles in ecological interactions and their possible applications in drug discovery, given the rich chemical arsenal produced by fungi like Penicillium purpurogenum. The findings underscore the significance of these metabolites in both chemistry and biology, paving the way for future research into their functional properties and therapeutic uses (PMID:34978193 ).
Structure
SynonymsNot Available
Molecular FormulaC26H30O9
Average Mass486.517
Monoisotopic Mass486.188982546
IUPAC Namemethyl (1'S,2R,2'S,12'R,14'R,17'R,19'S,21'R)-2',6',6',14',19'-pentamethyl-8',15',20'-trioxo-7',16',18'-trioxaspiro[oxirane-2,11'-pentacyclo[12.6.1.0^{2,12}.0^{5,10}.0^{17,21}]henicosane]-4',9'-diene-1'-carboxylate
Traditional Namemethyl (1'S,2R,2'S,12'R,14'R,17'R,19'S,21'R)-2',6',6',14',19'-pentamethyl-8',15',20'-trioxo-7',16',18'-trioxaspiro[oxirane-2,11'-pentacyclo[12.6.1.0^{2,12}.0^{5,10}.0^{17,21}]henicosane]-4',9'-diene-1'-carboxylate
CAS Registry NumberNot Available
SMILES
[H][C@]12OC(=O)[C@]3(C)C[C@@]4([H])[C@]5(CO5)C5=CC(=O)OC(C)(C)C5=CC[C@]4(C)[C@](C(=O)OC)(C(=O)[C@]([H])(C)O1)[C@]23[H]
InChI Identifier
InChI=1S/C26H30O9/c1-12-18(28)26(21(30)31-6)17-19(33-12)34-20(29)23(17,4)10-15-24(26,5)8-7-13-14(25(15)11-32-25)9-16(27)35-22(13,2)3/h7,9,12,15,17,19H,8,10-11H2,1-6H3/t12-,15+,17+,19+,23+,24-,25-,26-/m0/s1
InChI KeyXZKVBCSVEVIEBX-YJCISAIBSA-N