Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:46:37 UTC
Update Date2025-10-07 16:05:34 UTC
Metabolite IDMMDBc0009177
Metabolite Identification
Common NamePurple pigment
DescriptionPurple pigment is a type of anthocyanin, a class of flavonoid compounds known for their vibrant colors and significant roles in plant biology. This pigment is particularly noted for its diverse manifestations in sweetpotato, where it accumulates in varying degrees, contributing to the tuber's distinctive purple coloration (PMID:41012047 ). The biosynthesis of anthocyanins, including purple pigments, is regulated by a complex network of transcription factors, among which IbMYB2/3 have been identified as key players in fine-tuning the expression of genes involved in this pathway (PMID:41012047 ). These regulatory mechanisms not only influence the intensity and distribution of purple pigmentation but also play a role in the plant's response to environmental stressors, thereby enhancing its adaptability. In addition to their aesthetic appeal, anthocyanins possess antioxidant properties, suggesting potential health benefits for consumers. Overall, purple pigments represent an intriguing intersection of plant chemistry and biology, reflecting both the intricate genetic regulation of pigment production and the ecological significance of these metabolites.
Structure
SynonymsNot Available
Molecular FormulaC19H18N4O2
Average Mass334.379
Monoisotopic Mass334.142975836
IUPAC Name3-methoxy-2-{[3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]methylidene}-5-(1H-pyrrol-2-yl)-2H-pyrrole
Traditional Name3-methoxy-2-{[3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]methylidene}-5-(1H-pyrrol-2-yl)pyrrole
CAS Registry NumberNot Available
SMILES
COC1=CC(=NC1=CC1=C(OC)C=C(N1)C1=CC=CN1)C1=CC=CN1
InChI Identifier
InChI=1S/C19H18N4O2/c1-24-18-10-14(12-5-3-7-20-12)22-16(18)9-17-19(25-2)11-15(23-17)13-6-4-8-21-13/h3-11,20-22H,1-2H3
InChI KeyQEVDCWRFEOZGOP-UHFFFAOYSA-N