Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:54:05 UTC
Update Date2025-10-07 16:05:35 UTC
Metabolite IDMMDBc0009363
Metabolite Identification
Common NameCommunesin A
DescriptionCommunesin A is a Penicillium-derived alkaloid that belongs to the chemical class of metabolites. This compound is part of a diverse family of communesin alkaloids, which have garnered attention in recent synthetic and biological research. The total synthesis of communesin A and its related alkaloids has been explored through various innovative approaches, highlighting the compound's structural complexity and potential applications (PMID:26353936 ). Notably, the synthesis of communesin A has been achieved through P450-mediated coupling of indole fragments, showcasing the intricate chemistry involved in its formation (PMID:26963294 ). Furthermore, the producing organism, identified as Penicillium marinum, has been shown to accept modified amino acid analogues, leading to the generation of mono-fluoro-communesin analogues, which underscores the biological versatility of this metabolite (PMID:18280722 ). The production of communesin A along with other extrolites from fungal sources emphasizes its significance in both natural product chemistry and potential pharmacological applications (PMID:23173673 ). Recent collaborative syntheses have further advanced the understanding of communesin A, positioning it as a compound of interest in ongoing chemical and biological studies (PMID:31356068 ).
Structure
SynonymsNot Available
Molecular FormulaC28H32N4O2
Average Mass456.59
Monoisotopic Mass456.252526286
IUPAC Name1-[(2S,6R,14R,22R,25S)-25-(3,3-dimethyloxiran-2-yl)-15-methyl-1,3,13,15-tetraazaheptacyclo[18.4.1.0^{2,6}.0^{6,22}.0^{7,12}.0^{14,22}.0^{16,21}]pentacosa-7,9,11,16,18,20-hexaen-3-yl]ethan-1-one
Traditional Name1-[(2S,6R,14R,22R,25S)-25-(3,3-dimethyloxiran-2-yl)-15-methyl-1,3,13,15-tetraazaheptacyclo[18.4.1.0^{2,6}.0^{6,22}.0^{7,12}.0^{14,22}.0^{16,21}]pentacosa-7,9,11,16,18,20-hexaen-3-yl]ethanone
CAS Registry NumberNot Available
SMILES
[H]C1(OC1(C)C)[C@@]1([H])N2CC[C@]34C5=C1C=CC=C5N(C)[C@@]3([H])NC1=CC=CC=C1[C@]41CCN(C(C)=O)[C@]21[H]
InChI Identifier
InChI=1S/C28H32N4O2/c1-16(33)31-14-12-27-18-9-5-6-10-19(18)29-24-28(27)13-15-32(25(27)31)22(23-26(2,3)34-23)17-8-7-11-20(21(17)28)30(24)4/h5-11,22-25,29H,12-15H2,1-4H3/t22-,23?,24+,25+,27-,28-/m0/s1
InChI KeyQKUUVGNHUMKUAN-CBRPJXDCSA-N