Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:19:38 UTC
Update Date2025-10-07 16:05:41 UTC
Metabolite IDMMDBc0009988
Metabolite Identification
Common NameTricycloalternarene A
DescriptionTricycloalternarene A is a member of the chemical class of metabolites, specifically identified as an antimicrobial compound. It has been characterized through advanced analytical techniques such as ultra-performance liquid chromatography-tandem mass spectrometry (UPLC-MS/MS), which revealed its presence alongside other notable antimicrobial agents like Neoaspergillic acid and Antimycin A3 (PMID:41028187 ). This compound is derived from a symbiotic fungus, Aspergillus sp., indicating its potential ecological significance and biological activity (PMID:29642523 ). The structural complexity of tricycloalternarene A suggests it may interact with biological systems, possibly contributing to its antimicrobial properties. Further research into its mechanisms of action and potential applications in medicine could provide insights into its utility as a therapeutic agent against microbial infections.
Structure
SynonymsNot Available
Molecular FormulaC18H24O5
Average Mass320.385
Monoisotopic Mass320.162373873
IUPAC Name4-[(3S,7R,11S)-11-hydroxy-3-methyl-10-oxo-2-oxatricyclo[7.4.0.0^{3,7}]trideca-1(9),5-dien-6-yl]pentanoic acid
Traditional Name4-[(3S,7R,11S)-11-hydroxy-3-methyl-10-oxo-2-oxatricyclo[7.4.0.0^{3,7}]trideca-1(9),5-dien-6-yl]pentanoic acid
CAS Registry NumberNot Available
SMILES
[H]C(C)(CCC(O)=O)C1=CC[C@]2(C)OC3=C(C[C@]12[H])C(=O)[C@@]([H])(O)CC3
InChI Identifier
InChI=1S/C18H24O5/c1-10(3-6-16(20)21)11-7-8-18(2)13(11)9-12-15(23-18)5-4-14(19)17(12)22/h7,10,13-14,19H,3-6,8-9H2,1-2H3,(H,20,21)/t10?,13-,14+,18+/m1/s1
InChI KeyGFKPPJZEOXIRFX-ILLMFOQYSA-N