Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:20:33 UTC
Update Date2025-10-07 16:05:41 UTC
Metabolite IDMMDBc0010014
Metabolite Identification
Common NameCladobotrin V
DescriptionCladobotrin V is a known α-pyrone derivative, a chemical class characterized by a six-membered lactone ring containing a carbonyl group and an alkene. This compound was isolated from the culture broth of the mangrove endophyte Fusarium sp., highlighting its potential as a natural product of interest in both chemistry and biology (PMID:25355135 ). The α-pyrone structure is often associated with various biological activities, suggesting that Cladobotrin V may possess unique properties that warrant further investigation. The isolation of this metabolite from a mangrove endophyte indicates its ecological significance and potential applications in biochemistry and pharmacology, as endophytes are known to produce a wide range of bioactive compounds. Understanding the chemical characteristics and biological implications of Cladobotrin V could contribute to the discovery of new therapeutic agents or biotechnological applications, making it a valuable subject for ongoing research in natural product chemistry.
Structure
Synonyms
ValueSource
5-Hydroxymethyl-4-methoxy-6-(e-propenyl)-2-pyroneMeSH
Molecular FormulaC10H12O4
Average Mass196.202
Monoisotopic Mass196.073558866
IUPAC Name5-(hydroxymethyl)-4-methoxy-6-[(1E)-prop-1-en-1-yl]-2H-pyran-2-one
Traditional Name5-(hydroxymethyl)-4-methoxy-6-[(1E)-prop-1-en-1-yl]pyran-2-one
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(\[H])C1=C(CO)C(OC)=CC(=O)O1
InChI Identifier
InChI=1S/C10H12O4/c1-3-4-8-7(6-11)9(13-2)5-10(12)14-8/h3-5,11H,6H2,1-2H3/b4-3+
InChI KeyDFWGSIJBMOBCST-ONEGZZNKSA-N