Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:20:59 UTC
Update Date2025-10-07 16:05:41 UTC
Metabolite IDMMDBc0010027
Metabolite Identification
Common NameN-Hexanoyl-L-homoserine lactone
DescriptionN-Hexanoyl-L-homoserine lactone is a member of the acyl-homoserine lactones (AHLs), which are signaling molecules involved in quorum sensing in Gram-negative bacteria. This metabolite plays a pivotal role in bacterial communication, influencing various biological processes such as biofilm formation and virulence. Studies have shown that N-hexanoyl-L-homoserine lactone (C6-HSL) is the dominant AHL molecule produced by various bacterial strains (PMID:40637741 ). Its effects extend beyond bacterial signaling; for instance, it has been investigated for its role in the degradation of pollutants like sulfamethoxazole in aquaculture wastewater by Chlorella vulgaris (PMID:40188853 ). Additionally, the secretion of C6-HSL can be influenced by environmental factors such as ammonia stress, which can inhibit other AHLs while stimulating C6-HSL production (PMID:39505134 ). Molecular docking studies indicate that C6-HSL can competitively bind to receptors, affecting quorum sensing pathways (PMID:38667794 ). Its significance is further underscored in industrial contexts, particularly in addressing microbiologically influenced corrosion in oil and gas sectors (PMID:38693218 ). Overall, N-hexanoyl-L-homoserine lactone is a crucial compound in both microbial ecology and environmental biotechnology.
Structure
Synonyms
ValueSource
N-(2-Oxooxolan-3-yl)hexanimidateGenerator
Molecular FormulaC10H17NO3
Average Mass199.2469
Monoisotopic Mass199.120843415
IUPAC NameNot Available
Traditional NameNot Available
CAS Registry NumberNot Available
SMILESNot Available
InChI Identifier
InChI=1S/C10H17NO3/c1-2-3-4-5-9(12)11-8-6-7-14-10(8)13/h8H,2-7H2,1H3,(H,11,12)
InChI KeyZJFKKPDLNLCPNP-UHFFFAOYSA-N