Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:24:18 UTC
Update Date2025-10-07 16:05:42 UTC
Metabolite IDMMDBc0010120
Metabolite Identification
Common NameAsperaculane B
DescriptionAsperaculane B is a nordaucane-type sesquiterpenoid, classified as a fungal metabolite. It was isolated from a fermentation culture of the fungus Aspergillus aculeatus, alongside other sesquiterpenoids (PMID:25547729 ). This compound has garnered attention for its biological activity, particularly its role as a dual-functional antimalarial lead. Research indicates that asperaculane B effectively inhibits malaria infection and transmission, showcasing its potential as a therapeutic agent against malaria (PMID:32630339 ). Furthermore, it has been shown to inhibit the development of asexual Plasmodium, the parasite responsible for malaria, highlighting its significance in both treating the disease and preventing its spread (PMID:32630339 ). The identification and characterization of asperaculane B underscore the importance of natural products in the search for novel antimalarial compounds, providing a promising avenue for future drug development.
Structure
SynonymsNot Available
Molecular FormulaC14H20O3
Average Mass236.311
Monoisotopic Mass236.141244504
IUPAC Name(3aR,8S,8aR)-3-ethyl-8-hydroxy-6-(hydroxymethyl)-8a-methyl-1,3a,4,7,8,8a-hexahydroazulen-1-one
Traditional Name(3aR,8S,8aR)-3-ethyl-8-hydroxy-6-(hydroxymethyl)-8a-methyl-3a,4,7,8-tetrahydroazulen-1-one
CAS Registry NumberNot Available
SMILES
[H][C@]12CC=C(CO)C[C@]([H])(O)[C@]1(C)C(=O)C=C2CC
InChI Identifier
InChI=1S/C14H20O3/c1-3-10-7-13(17)14(2)11(10)5-4-9(8-15)6-12(14)16/h4,7,11-12,15-16H,3,5-6,8H2,1-2H3/t11-,12+,14-/m1/s1
InChI KeyGFYHPKUYDFUKNL-MBNYWOFBSA-N