Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:25:06 UTC
Update Date2025-10-07 16:05:42 UTC
Metabolite IDMMDBc0010138
Metabolite Identification
Common NameMethanofuran
DescriptionMethanofuran is a coenzyme belonging to the class of metabolites known as methanofurans, which play a crucial role in the methanogenic pathway of archaea. This compound serves as a primary C1 acceptor during carbon dioxide fixation, facilitating the reduction and condensation of CO2 to formyl-methanofuran, a reaction catalyzed by formyl-methanofuran dehydrogenase (Fmd) (PMID:34516836 ). Methanofuran is integral to the functioning of multienzymatic complexes like FMDs, which are highly efficient in biological CO2 conversion (PMID:39584476 ). The biosynthesis of methanofurans involves specific enzymes, such as MfnB, which catalyzes the condensation of glyceraldehyde-3-phosphate to produce 4‑(hydroxymethyl)-2-furancarboxaldehyde-phosphate (PMID:39215799 ). The conservation of methanofuran and related coenzymes has been highlighted through purifying selection analyses, underscoring their critical metabolic functions (PMID:40051064 ). Furthermore, environmental factors such as plasticizers and antibiotics have been shown to inhibit methanofuran biosynthesis, thereby impacting methane metabolism and overall microbial activity (PMIDs:38759407, 34530275). Understanding the biochemical pathways involving methanofuran is essential for elucidating the mechanisms of archaeal methanogenesis and its ecological implications.
Structure
Synonyms
ValueSource
CDR FactorMeSH
Carbon dioxide reduction factorMeSH
Molecular FormulaC34H44N4O15
Average Mass748.739
Monoisotopic Mass748.280316733
IUPAC Name1-[2-({3-[(3-{[2-(4-{[5-(aminomethyl)furan-3-yl]methoxy}phenyl)ethyl]-C-hydroxycarbonimidoyl}-1-carboxypropyl)-C-hydroxycarbonimidoyl]-1-carboxypropyl}-C-hydroxycarbonimidoyl)ethyl]butane-1,2,4-tricarboxylic acid
Traditional Name1-[2-({3-[(3-{[2-(4-{[5-(aminomethyl)furan-3-yl]methoxy}phenyl)ethyl]-C-hydroxycarbonimidoyl}-1-carboxypropyl)-C-hydroxycarbonimidoyl]-1-carboxypropyl}-C-hydroxycarbonimidoyl)ethyl]butane-1,2,4-tricarboxylic acid
CAS Registry NumberNot Available
SMILES
NCC1=CC(COC2=CC=C(CCN=C(O)CCC(N=C(O)CCC(N=C(O)CCC(C(CCC(O)=O)C(O)=O)C(O)=O)C(O)=O)C(O)=O)C=C2)=CO1
InChI Identifier
InChI=1S/C34H44N4O15/c35-16-22-15-20(18-53-22)17-52-21-3-1-19(2-4-21)13-14-36-27(39)10-7-25(33(48)49)38-29(41)11-8-26(34(50)51)37-28(40)9-5-23(31(44)45)24(32(46)47)6-12-30(42)43/h1-4,15,18,23-26H,5-14,16-17,35H2,(H,36,39)(H,37,40)(H,38,41)(H,42,43)(H,44,45)(H,46,47)(H,48,49)(H,50,51)
InChI KeyCKRUWFDORAQSRC-UHFFFAOYSA-N