Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:50:56 UTC
Update Date2025-10-07 16:05:47 UTC
Metabolite IDMMDBc0010761
Metabolite Identification
Common NameAqabamycin D
DescriptionAqabamycin D is a maleimide derivative, a chemical class known for its diverse biological activities. It was isolated alongside several other novel compounds, including aqabamycin A, B, C, E, F, and G, as well as known metabolites such as 3-nitro-1H-indazole and indazole-3-carbaldehyde (PMID: 32931234 ). The maleimide structure is characterized by a five-membered ring containing a carbonyl group and a nitrogen atom, which can engage in various chemical reactions, making these compounds of interest for potential therapeutic applications. The biological significance of aqabamycin D, along with its analogs, stems from their potential interactions with cellular processes, although detailed studies on their specific mechanisms of action are still required. The isolation of such compounds highlights the ongoing exploration of natural products in drug discovery, particularly those derived from microbial sources, which often yield novel structures with promising biological activities. Further research is necessary to fully elucidate the pharmacological properties and potential applications of aqabamycin D in medicine.
Structure
SynonymsNot Available
Molecular FormulaC16H9N3O8
Average Mass371.261
Monoisotopic Mass371.038964262
IUPAC Name5-hydroxy-3,4-bis(4-hydroxy-3-nitrophenyl)-2H-pyrrol-2-one
Traditional Name5-hydroxy-3,4-bis(4-hydroxy-3-nitrophenyl)pyrrol-2-one
CAS Registry NumberNot Available
SMILES
OC1=NC(=O)C(=C1C1=CC(=C(O)C=C1)N(=O)=O)C1=CC(=C(O)C=C1)N(=O)=O
InChI Identifier
InChI=1S/C16H9N3O8/c20-11-3-1-7(5-9(11)18(24)25)13-14(16(23)17-15(13)22)8-2-4-12(21)10(6-8)19(26)27/h1-6,20-21H,(H,17,22,23)
InChI KeyORKTZLAOMXYSNI-UHFFFAOYSA-N