Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:55:21 UTC
Update Date2025-10-07 16:05:48 UTC
Metabolite IDMMDBc0010876
Metabolite Identification
Common NameLeptosphaerone C
DescriptionLeptosphaerone C is a polyketide metabolite described in biomedical literature. It was isolated from the fungus Penicillium sp., alongside other compounds such as penicillenone, arugosin I, and 9-demethyl FR-901235, as well as five known compounds including bacillosporin A, bacillosporin C, sequoiamonascin D, sequoiatone A, and sequoiatone B (PMID:18067932 ). Polyketides like Leptosphaerone C are known for their diverse biological activities, which can include antimicrobial, antifungal, and anticancer properties. The structural complexity of polyketides arises from their biosynthetic pathways, which involve the assembly of acetate and other building blocks through the action of polyketide synthases. Understanding the chemistry and biological functions of Leptosphaerone C and its related compounds is essential for exploring their potential applications in pharmaceuticals and biotechnology.
Structure
Synonyms
ValueSource
(2S,3R)-2,3-Dihydroxy-2,5-dimethylcyclohex-5-enoneMeSH
Molecular FormulaC8H12O3
Average Mass156.181
Monoisotopic Mass156.078644246
IUPAC Name(5R,6S)-5,6-dihydroxy-3,6-dimethylcyclohex-2-en-1-one
Traditional Name(5R,6S)-5,6-dihydroxy-3,6-dimethylcyclohex-2-en-1-one
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)CC(C)=CC(=O)[C@@]1(C)O
InChI Identifier
InChI=1S/C8H12O3/c1-5-3-6(9)8(2,11)7(10)4-5/h3,7,10-11H,4H2,1-2H3/t7-,8-/m1/s1
InChI KeyJPANATRWCFTRDD-HTQZYQBOSA-N