Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 02:56:21 UTC
Update Date2025-10-07 16:05:48 UTC
Metabolite IDMMDBc0010904
Metabolite Identification
Common NameDeoxyanserinone B
DescriptionDeoxyanserinone B is a member of the anthraquinone chemical class, characterized by its structural features that include multiple methoxy groups. This compound has garnered attention in biomedical literature for its notable antimicrobial properties, demonstrated through studies revealing substantial efficacy against various microbial strains, including V. (PMID:38151632 ). Deoxyanserinone B, along with related compounds such as 1-hydroxy-2,6,8-trimethoxy-9,10-anthraquinone and khatmiamycin, exhibited antimicrobial activity comparable to standard antibiotics like amoxicillin, with effective concentrations ranging between 7 and 38 μg/mL (PMID:38151632 ). Additionally, deoxyanserinone B has been identified as a minor constituent in certain extracts, although it has not been completely purified in some studies (PMID:15043411 ). The potential of deoxyanserinone B in therapeutic applications, particularly in combating microbial infections, highlights its significance within the realm of natural product chemistry and pharmacology. Further research is warranted to fully elucidate its mechanisms of action and potential clinical applications.
Structure
SynonymsNot Available
Molecular FormulaC11H16O3
Average Mass196.246
Monoisotopic Mass196.109944375
IUPAC Name3-(2-hydroxypropyl)-5-methoxy-2-methylphenol
Traditional Name3-(2-hydroxypropyl)-5-methoxy-2-methylphenol
CAS Registry NumberNot Available
SMILES
COC1=CC(O)=C(C)C(CC(C)O)=C1
InChI Identifier
InChI=1S/C11H16O3/c1-7(12)4-9-5-10(14-3)6-11(13)8(9)2/h5-7,12-13H,4H2,1-3H3
InChI KeyVOVNVNDGBNLJJB-UHFFFAOYSA-N