Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:02:59 UTC
Update Date2025-10-07 16:05:49 UTC
Metabolite IDMMDBc0011084
Metabolite Identification
Common NameTryprostatin B
DescriptionTryprostatin B is a dipeptide belonging to the class of bioactive compounds. It has a molecular weight of 351.45 Da, as identified through LC-MS analysis, and is known for its potential therapeutic applications, particularly in cancer biology. This compound is synthesized by the fungus Aspergillus sp., which is capable of producing a diverse array of bioactive metabolites, including Tryprostatin B itself, as well as other compounds like Fasoracetam and Brevianamide F (PMID:38344285 ). Molecular docking studies suggest that Tryprostatin B can effectively interact with key receptors involved in breast cancer, indicating its potential role in cancer treatment (PMID:38344285 ). Additionally, innovative chemoenzymatic approaches have been developed to modify Tryprostatin B, enhancing its structural diversity and potential efficacy (PMID:33643664 ). Total synthesis methods have also been explored, demonstrating the compound's significance in medicinal chemistry and its application as a microtubule inhibitor (PMID:30561217 ). The ongoing research into Tryprostatin B highlights its relevance in both chemical synthesis and biological activity, making it a compound of interest in the field of drug discovery.
Structure
Synonyms
ValueSource
Triprostatin bChEBI
Molecular FormulaC21H25N3O2
Average Mass351.45
Monoisotopic Mass351.194677057
IUPAC Name(3S,8aS)-1-hydroxy-3-{[2-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}-3H,4H,6H,7H,8H,8aH-pyrrolo[1,2-a]pyrazin-4-one
Traditional Name(3S,8aS)-1-hydroxy-3-{[2-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}-3H,6H,7H,8H,8aH-pyrrolo[1,2-a]pyrazin-4-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCCN1C(=O)[C@]([H])(CC1=C(CC=C(C)C)NC3=CC=CC=C13)N=C2O
InChI Identifier
InChI=1S/C21H25N3O2/c1-13(2)9-10-17-15(14-6-3-4-7-16(14)22-17)12-18-21(26)24-11-5-8-19(24)20(25)23-18/h3-4,6-7,9,18-19,22H,5,8,10-12H2,1-2H3,(H,23,25)/t18-,19-/m0/s1
InChI KeyGLWYBXPXOSKQAW-OALUTQOASA-N