Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:04:33 UTC
Update Date2025-10-07 16:05:49 UTC
Metabolite IDMMDBc0011122
Metabolite Identification
Common NameNK13650B
DescriptionNK13650B is a fungal metabolite classified within the chemical class of histone acetyltransferase (HAT) inhibitors. It was identified through the cultivation of a production strain from the genus Penicillium, which led to the discovery of NK13650B alongside another compound, NK13650A. The primary biological activity attributed to NK13650B is its specific inhibition of the p300 HAT, an enzyme that plays a crucial role in the regulation of gene expression through histone acetylation. This inhibition suggests potential implications for cancer therapy, as p300 is often implicated in oncogenic processes. The characterization of NK13650B adds to the understanding of the diverse chemical arsenal produced by fungal species, highlighting their potential as sources of novel bioactive compounds. The identification of such metabolites is significant for developing new therapeutic agents that target epigenetic modifications, which are increasingly recognized for their role in various diseases. Further research into NK13650B could elucidate its mechanism of action and therapeutic potential in the context of diseases associated with dysregulated histone acetylation (PMID:22984806 ).
Structure
SynonymsNot Available
Molecular FormulaC25H32N6O12
Average Mass608.561
Monoisotopic Mass608.207820494
IUPAC Name2-({[3-(5-{[5-(3-carbamimidamidopropyl)-6-hydroxy-3-oxo-2,3,4,5-tetrahydropyrazin-2-ylidene]methyl}-2-hydroxyphenoxy)-1-carboxypropyl]-C-hydroxycarbonimidoyl}methyl)-2-hydroxybutanedioic acid
Traditional Name2-({[3-(5-{[5-(3-carbamimidamidopropyl)-6-hydroxy-3-oxo-4,5-dihydropyrazin-2-ylidene]methyl}-2-hydroxyphenoxy)-1-carboxypropyl]-C-hydroxycarbonimidoyl}methyl)-2-hydroxybutanedioic acid
CAS Registry NumberNot Available
SMILES
NC(=N)NCCCC1NC(=O)C(=CC2=CC=C(O)C(OCCC(N=C(O)CC(O)(CC(O)=O)C(O)=O)C(O)=O)=C2)N=C1O
InChI Identifier
InChI=1S/C25H32N6O12/c26-24(27)28-6-1-2-13-20(36)31-15(21(37)30-13)8-12-3-4-16(32)17(9-12)43-7-5-14(22(38)39)29-18(33)10-25(42,23(40)41)11-19(34)35/h3-4,8-9,13-14,32,42H,1-2,5-7,10-11H2,(H,29,33)(H,30,37)(H,31,36)(H,34,35)(H,38,39)(H,40,41)(H4,26,27,28)
InChI KeyGRAFKVRBLJRCBH-UHFFFAOYSA-N