Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:07:54 UTC
Update Date2025-10-07 16:05:49 UTC
Metabolite IDMMDBc0011208
Metabolite Identification
Common NameTrichodermamide A
DescriptionTrichodermamide A is a polyketide derivative that belongs to the chemical class of epidithiodiketopiperazines. This compound has been isolated from various species of the Trichoderma genus, including Trichoderma harzianum and Trichoderma lixii, through bioactivity-guided investigations aimed at identifying selective growth inhibitors for cancer cells (PMIDs: 38731537, 32676071, 31435860). Although trichodermamide A has been characterized alongside other compounds such as trichodermamide B and aspergillazine A, it has been reported to be devoid of cytotoxic activity against HCT-116 colorectal cancer cells (PMID: 28051860 ). The synthesis of trichodermamide A has been achieved in gram quantities, demonstrating its accessibility for further study (PMID: 26084356 ). Additionally, the transformation of irregularly bridged epidithiodiketopiperazines into trichodermamide A highlights its structural complexity and potential for further chemical exploration (PMIDs: 16805555). Overall, trichodermamide A represents a significant metabolite within the Trichoderma species, contributing to the understanding of fungal bioactive compounds and their potential applications in cancer research.
Structure
SynonymsNot Available
Molecular FormulaC20H20N2O9
Average Mass432.385
Monoisotopic Mass432.116880232
IUPAC Name(4aS,5R,8R,8aS)-N-(7,8-dimethoxy-2-oxo-2H-chromen-3-yl)-4a,5,8-trihydroxy-4a,5,8,8a-tetrahydro-4H-1,2-benzoxazine-3-carboxamide
Traditional Name(4aS,5R,8R,8aS)-N-(7,8-dimethoxy-2-oxochromen-3-yl)-4a,5,8-trihydroxy-4,5,8,8a-tetrahydro-1,2-benzoxazine-3-carboxamide
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)C=C[C@@]([H])(O)[C@@]2(O)CC(=NO[C@@]12[H])C(=O)NC1=CC2=C(OC1=O)C(OC)=C(OC)C=C2
InChI Identifier
InChI=1S/C20H20N2O9/c1-28-13-5-3-9-7-10(19(26)30-15(9)16(13)29-2)21-18(25)11-8-20(27)14(24)6-4-12(23)17(20)31-22-11/h3-7,12,14,17,23-24,27H,8H2,1-2H3,(H,21,25)/t12-,14-,17+,20+/m1/s1
InChI KeyZQOKLOPATOTAEE-OVCSSCHWSA-N