Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:12:53 UTC
Update Date2025-10-07 16:05:50 UTC
Metabolite IDMMDBc0011301
Metabolite Identification
Common NameStevastelin B
DescriptionStevastelin B is a novel 15-membered cyclic depsipeptide, classified within the chemical class of cyclic peptides. It is composed of amino acids valine, threonine, serine, and 3,5-dihydroxy-2,4-dimethyl stearic acid. The total synthesis of stevastelin B has been achieved using a macrolactamization process, which effectively constructs its cyclic structure (PMID:12109115 ). This compound has been shown to inhibit gene expression dependent on interleukin-2 (IL-2) or IL-6 promoters in situ, highlighting its potential as an immunosuppressant (PMID:9195865 ). Interestingly, stevastelin B does not exhibit inhibitory activity against protein phosphatases in vitro, suggesting a specific mechanism of action that may involve post-translational modifications such as sulphonylation or phosphorylation upon incorporation into target cells (PMID:9195865 ). The synthesis of stevastelin B and its analogues has been detailed in the literature, showcasing its structural complexity and potential biological significance (PMID:16277304 ). Overall, stevastelin B represents a unique entity within the stevastelin family, with implications for further research in immunomodulation and therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC34H61N3O9
Average Mass655.874
Monoisotopic Mass655.440780556
IUPAC Name[(3S,6S,9S)-5,8,11,13-tetrahydroxy-6-[(1R)-1-hydroxyethyl]-12,14-dimethyl-2-oxo-9-(propan-2-yl)-15-tridecyl-1-oxa-4,7,10-triazacyclopentadeca-4,7,10-trien-3-yl]methyl acetate
Traditional Name[(3S,6S,9S)-5,8,11,13-tetrahydroxy-6-[(1R)-1-hydroxyethyl]-9-isopropyl-12,14-dimethyl-2-oxo-15-tridecyl-1-oxa-4,7,10-triazacyclopentadeca-4,7,10-trien-3-yl]methyl acetate
CAS Registry NumberNot Available
SMILES
[H][C@](C)(O)[C@]1([H])N=C(O)[C@@]([H])(N=C(O)C([H])(C)C([H])(O)C([H])(C)C([H])(CCCCCCCCCCCCC)OC(=O)[C@]([H])(COC(C)=O)N=C1O)C(C)C
InChI Identifier
InChI=1S/C34H61N3O9/c1-8-9-10-11-12-13-14-15-16-17-18-19-27-22(4)30(40)23(5)31(41)36-28(21(2)3)32(42)37-29(24(6)38)33(43)35-26(34(44)46-27)20-45-25(7)39/h21-24,26-30,38,40H,8-20H2,1-7H3,(H,35,43)(H,36,41)(H,37,42)/t22?,23?,24-,26+,27?,28+,29+,30?/m1/s1
InChI KeyUTYDHKYGSNIIDV-CSFMTDHRSA-N