Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:17:38 UTC
Update Date2025-10-07 16:05:51 UTC
Metabolite IDMMDBc0011433
Metabolite Identification
Common NameMevinolinic acid
DescriptionMevinolinic acid is a secondary metabolite belonging to the class of polyketides, specifically recognized as the acidic form of lovastatin. It is produced through the biosynthetic pathways of certain fungi, notably Aspergillus terreus, in co-culture systems with bacteria such as Streptomyces rimosus, which enhance its production alongside other metabolites (PMID:39644383 ). The biosynthesis of mevinolinic acid is influenced by various factors, including the choice of co-cultivated species and the cultivation conditions, such as initial pH of the medium (PMID:31098686 , PMID:22995742 ). Studies have shown that acidic conditions can lead to underestimation of mevinolinic acid levels during chromatographic assays, necessitating careful consideration of pH when analyzing its biosynthesis (PMID:22995742 ). Additionally, mevinolinic acid is often found alongside other secondary metabolites like terreic acid and citrinin, indicating its role in the complex metabolic networks of these organisms (PMID:24534845 ). Overall, mevinolinic acid is not only significant for its pharmacological properties but also serves as a crucial marker in the study of fungal secondary metabolism.
Structure
SynonymsNot Available
Molecular FormulaC24H38O6
Average Mass422.562
Monoisotopic Mass422.266838944
IUPAC Name(3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-{[(2R)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid
Traditional Name(3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-{[(2R)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](O)(CC[C@@]1([H])[C@@]([H])(C)C=CC2=C[C@]([H])(C)C[C@]([H])(OC(=O)[C@]([H])(C)CC)[C@]12[H])C[C@@]([H])(O)CC(O)=O
InChI Identifier
InChI=1S/C24H38O6/c1-5-15(3)24(29)30-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-18(25)12-19(26)13-22(27)28/h6-7,10,14-16,18-21,23,25-26H,5,8-9,11-13H2,1-4H3,(H,27,28)/t14-,15+,16-,18+,19+,20-,21-,23-/m0/s1
InChI KeyQLJODMDSTUBWDW-YPQFMRJXSA-N