Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:26:46 UTC
Update Date2025-10-07 16:05:53 UTC
Metabolite IDMMDBc0011650
Metabolite Identification
Common NameTricycloalternarene B
DescriptionTricycloalternarene B is a tricyclic compound belonging to the class of metabolites known as alternarenes. This compound has garnered attention in the field of organic chemistry due to its unique structural features and potential biological activities. Recent studies have focused on the structural revisions of various compounds in this class, including tricycloalternarene B, highlighting its significance among related metabolites. The exploration of tricycloalternarene B and its analogs may provide insights into their biological roles and applications, particularly in the context of natural product chemistry and pharmacology. Such metabolites often exhibit diverse biological activities, which could be relevant for therapeutic development. The ongoing research into tricycloalternarene B and its derivatives underscores the importance of understanding the structural and functional relationships within this chemical class (PMID:35738433 ).
Structure
SynonymsNot Available
Molecular FormulaC23H32O5
Average Mass388.504
Monoisotopic Mass388.22497413
IUPAC Name(2E)-6-[(3S,7R,11S)-11-hydroxy-3-methyl-10-oxo-2-oxatricyclo[7.4.0.0^{3,7}]trideca-1(9),5-dien-6-yl]-2-methylhept-2-en-1-yl acetate
Traditional Name(2E)-6-[(3S,7R,11S)-11-hydroxy-3-methyl-10-oxo-2-oxatricyclo[7.4.0.0^{3,7}]trideca-1(9),5-dien-6-yl]-2-methylhept-2-en-1-yl acetate
CAS Registry NumberNot Available
SMILES
[H]\C(CCC([H])(C)C1=CC[C@]2(C)OC3=C(C[C@]12[H])C(=O)[C@@]([H])(O)CC3)=C(\C)COC(C)=O
InChI Identifier
InChI=1S/C23H32O5/c1-14(13-27-16(3)24)6-5-7-15(2)17-10-11-23(4)19(17)12-18-21(28-23)9-8-20(25)22(18)26/h6,10,15,19-20,25H,5,7-9,11-13H2,1-4H3/b14-6+/t15?,19-,20+,23+/m1/s1
InChI KeyVGHJOPSBAYWMSB-ZMLYTDBKSA-N