Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:28:41 UTC
Update Date2025-10-07 16:05:53 UTC
Metabolite IDMMDBc0011704
Metabolite Identification
Common Name7-deacetoxyyanuthone
Description7-deacetoxyyanuthone is a polyoxygenated farnesylcyclohexenone, a class of compounds known for their diverse biological activities and structural complexity. This metabolite has been identified in marine isolates of the genus Penicillium, where it was isolated alongside other farnesylquinones (PMID:14640527 ). The compound is notable for its potential biological significance, as it belongs to a group of meroterpenoids that exhibit various pharmacological properties. In a study focusing on the characterization of compounds, 7-deacetoxyyanuthone was reisolated and recognized as a stable tautomer of oxosorbicillinol (PMID:15974609 ). The structural features of 7-deacetoxyyanuthone contribute to its reactivity and interactions in biological systems, making it a subject of interest for further research into its potential applications in medicine and biochemistry.
Structure
SynonymsNot Available
Molecular FormulaC22H32O3
Average Mass344.495
Monoisotopic Mass344.23514489
IUPAC Name(1R,5R,6R)-5-hydroxy-4-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-7-oxabicyclo[4.1.0]hept-3-en-2-one
Traditional Name(1R,5R,6R)-5-hydroxy-4-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-7-oxabicyclo[4.1.0]hept-3-en-2-one
CAS Registry NumberNot Available
SMILES
[H]\C(CC\C(C)=C(/[H])C[C@@]12O[C@]1([H])[C@]([H])(O)C(C)=CC2=O)=C(\C)CCC=C(C)C
InChI Identifier
InChI=1S/C22H32O3/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22-19(23)14-18(5)20(24)21(22)25-22/h8,10,12,14,20-21,24H,6-7,9,11,13H2,1-5H3/b16-10+,17-12+/t20-,21-,22+/m1/s1
InChI KeyDKOXVDVXOYHFHV-ITGDQCKOSA-N