Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:07:51 UTC
Update Date2025-10-07 16:06:01 UTC
Metabolite IDMMDBc0012635
Metabolite Identification
Common NameTerritrem B
DescriptionTerritrem B is a meroterpenoid, a chemical class that combines elements of terpenes and other organic compounds, and is characterized as a significant metabolite derived from the fermentation extract of fungi such as Alternaria sp. This compound has been identified as an acetylcholinesterase (AChE) inhibitor, demonstrating notable activity against various biological targets, including the prevention of Phytophthora blight caused by Phytophthora capsici (PMID:40638848 ). The compound's structure allows it to bind to AChE, affecting both the active and peripheral sites, which contributes to its inhibitory potency (PMIDs:24900610, 24573600). Additionally, in vitro studies have shown that territrem B can reduce apoptotic cell death under normal culture conditions when used alongside other AChE inhibitors (PMID:32761307 ). Its unique conformational characteristics, particularly in the E-ring, are believed to influence its binding affinity and mechanism of action against AChE (PMID:40863500 ). Overall, territrem B represents a promising natural product with potential applications in both agricultural and medicinal fields due to its bioactive properties.
Structure
SynonymsNot Available
Molecular FormulaC29H34O10
Average Mass542.581
Monoisotopic Mass542.215197295
IUPAC Name(1S,2S,11R,14R)-2,14-dihydroxy-11,15,15-trimethyl-7-(3,4,5-trimethoxyphenyl)-6,10,17-trioxapentacyclo[14.2.2.0^{1,14}.0^{2,11}.0^{4,9}]icosa-4(9),7-diene-5,19-dione
Traditional Name(1S,2S,11R,14R)-2,14-dihydroxy-11,15,15-trimethyl-7-(3,4,5-trimethoxyphenyl)-6,10,17-trioxapentacyclo[14.2.2.0^{1,14}.0^{2,11}.0^{4,9}]icosa-4(9),7-diene-5,19-dione
CAS Registry NumberNot Available
SMILES
[H]C12CC(=O)[C@@]3(CO1)[C@@](O)(CC[C@@]1(C)OC4=C(C[C@]31O)C(=O)OC(=C4)C1=CC(OC)=C(OC)C(OC)=C1)C2(C)C
InChI Identifier
InChI=1S/C29H34O10/c1-25(2)22-12-21(30)27(14-37-22)28(25,32)8-7-26(3)29(27,33)13-16-18(39-26)11-17(38-24(16)31)15-9-19(34-4)23(36-6)20(10-15)35-5/h9-11,22,32-33H,7-8,12-14H2,1-6H3/t22?,26-,27+,28-,29-/m1/s1
InChI KeyATLGSZPVKAPATP-QNEAMCJZSA-N