Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:10:23 UTC
Update Date2025-10-07 16:06:02 UTC
Metabolite IDMMDBc0012698
Metabolite Identification
Common NameFarinamycin
DescriptionFarinamycin is a quinazoline, a chemical class characterized by a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This metabolite is produced by the bacterium Streptomyces griseus, which is well-known for its ability to produce various bioactive compounds, including phenoxazinone antibiotics. The isolation of farinamycin occurred after fermentation in a flour-based medium, highlighting the potential of utilizing different substrates to enhance the production of novel metabolites. The discovery of farinamycin adds to the diverse array of secondary metabolites produced by Streptomyces species and underscores the significance of these bacteria in natural product chemistry and drug discovery. The unique structural features of quinazolines, including their nitrogen-containing rings, contribute to their biological activities, making farinamycin a compound of interest for further investigation in both chemistry and pharmacology. The exploration of farinamycin's properties may reveal insights into its mechanism of action and potential applications in medicine. (PMID:21939253 )
Structure
SynonymsNot Available
Molecular FormulaC21H19N5O7
Average Mass453.411
Monoisotopic Mass453.128447972
IUPAC Name(3R,4R,5R)-3-{[5-(4,8-dihydroxyquinazolin-2-yl)-2-hydroxyphenyl]amino}-2,4,5-trihydroxy-6-iminocyclohex-1-ene-1-carboximidic acid
Traditional Name(3R,4R,5R)-3-{[5-(4,8-dihydroxyquinazolin-2-yl)-2-hydroxyphenyl]amino}-2,4,5-trihydroxy-6-iminocyclohex-1-ene-1-carboximidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)C(=N)C(C(O)=N)=C(O)[C@]([H])(NC2=C(O)C=CC(=C2)C2=NC3=C(C=CC=C3O)C(O)=N2)[C@@]1([H])O
InChI Identifier
InChI=1S/C21H19N5O7/c22-13-12(19(23)32)16(29)15(18(31)17(13)30)24-9-6-7(4-5-10(9)27)20-25-14-8(21(33)26-20)2-1-3-11(14)28/h1-6,15,17-18,22,24,27-31H,(H2,23,32)(H,25,26,33)/t15-,17+,18+/m0/s1
InChI KeyCSYYLLBGIIYORZ-CGTJXYLNSA-N