Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:11:14 UTC
Update Date2025-10-07 16:06:02 UTC
Metabolite IDMMDBc0012722
Metabolite Identification
Common NameNeoergosterol
DescriptionNeoergosterol is a sterol, a class of organic compounds characterized by a four-ring structure and a hydroxyl group. It is a metabolite identified in various biological contexts, particularly within fungal species. Neoergosterol has been detected alongside other sterols such as ergosta-3,5,7,9(11),22-pentaene and stigmasterol in crude extracts, highlighting its presence in complex biological matrices (PMID:27198920 ). Research has elucidated aspects of its biogenesis, suggesting a regulatory role in sterol biosynthesis within fungi, alongside other compounds like phycomysterols (PMID:11958798 ). The structural characterization of neoergosterol has been confirmed through chemical synthesis, reinforcing its significance in metabolic pathways (PMID:9868149 ). Additionally, neoergosterol can undergo chemical transformations, such as oxidation leading to the formation of neoergosterone enol-trimethylsilyl ether (PMID:1268323 ), and it can be converted from ergosterol via direct peroxide cleavage, illustrating its potential biological and chemical versatility (PMID:5117701 ). Overall, neoergosterol represents an important compound in the study of sterols, with implications for both chemistry and biology.
Structure
SynonymsNot Available
Molecular FormulaC27H40O
Average Mass380.616
Monoisotopic Mass380.307915908
IUPAC Name(5S,11R,15R)-14-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-1(10),2(7),8-trien-5-ol
Traditional Name(5S,11R,15R)-14-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-1(10),2(7),8-trien-5-ol
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])[C@@]([H])(C)C1([H])CC[C@@]2([H])C3=C(CC[C@]12C)C1=C(C[C@@]([H])(O)CC1)C=C3)[C@]([H])(C)C(C)C
InChI Identifier
InChI=1S/C27H40O/c1-17(2)18(3)6-7-19(4)25-12-13-26-24-10-8-20-16-21(28)9-11-22(20)23(24)14-15-27(25,26)5/h6-8,10,17-19,21,25-26,28H,9,11-16H2,1-5H3/b7-6+/t18-,19+,21-,25?,26-,27+/m0/s1
InChI KeyMNMJPUHGVUDRCV-PBUYBTHQSA-N