Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:28:16 UTC
Update Date2025-10-07 16:06:05 UTC
Metabolite IDMMDBc0013087
Metabolite Identification
Common NameArdeemin
DescriptionArdeemin is a cyclic tripeptide derivative belonging to the class of non-ribosomal peptides, primarily synthesized by fungi such as Aspergillus fischeri. This compound is notable for its complex biosynthetic pathway, which involves the non-ribosomal peptide synthetase ArdA and the prenyltransferase ArdB, leading to the formation of the pharmaceutically active hexacyclic structure of ardeemin fumiquinazoline (FQ). Recent studies have identified several ardeemin analogs, including alboluteins A-C, derived from the solid rice-based cultures of Malbranchea albolutea (PMID:33524855 ). Additionally, research has highlighted the potential of ardeemin derivatives, such as 5-N-acetylardeemin and 5-N-formylardeemin, in reversing multidrug resistance in cancer cells, enhancing the efficacy of chemotherapeutic agents like doxorubicin and vincristine (PMID:24858827 ). The synthesis of these derivatives has been achieved through innovative methods, including Ugi three-component reactions (PMID:25835358 ). Furthermore, ardeemin and its enantiomer are recognized as potential substrates for aromatic prenyltransferases, showcasing their significance in biochemical pathways (PMID:30863875 ). Overall, ardeemin and its derivatives exhibit promising biological activities, particularly in cancer treatment strategies.
Structure
SynonymsNot Available
Molecular FormulaC26H26N4O2
Average Mass426.52
Monoisotopic Mass426.205576093
IUPAC Name(1S,12R,15S,23R)-12-methyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetraazahexacyclo[12.10.0.0^{2,11}.0^{4,9}.0^{15,23}.0^{17,22}]tetracosa-2,4,6,8,17,19,21-heptaene-10,13-dione
Traditional Name(1S,12R,15S,23R)-12-methyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetraazahexacyclo[12.10.0.0^{2,11}.0^{4,9}.0^{15,23}.0^{17,22}]tetracosa-2,4,6,8,17,19,21-heptaene-10,13-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]12C[C@]3(C4=CC=CC=C4N[C@@]3([H])N1C(=O)[C@@]([H])(C)N1C(=O)C3=CC=CC=C3N=C21)C(C)(C)C=C
InChI Identifier
InChI=1S/C26H26N4O2/c1-5-25(3,4)26-14-20-21-27-18-12-8-6-10-16(18)23(32)29(21)15(2)22(31)30(20)24(26)28-19-13-9-7-11-17(19)26/h5-13,15,20,24,28H,1,14H2,2-4H3/t15-,20+,24+,26-/m1/s1
InChI KeyDNOJISVGBFLJOQ-BXVKCURFSA-N