Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:28:54 UTC
Update Date2025-10-07 16:06:05 UTC
Metabolite IDMMDBc0013102
Metabolite Identification
Common NameSpiruchostatin B
DescriptionSpiruchostatin B is a potent histone deacetylase (HDAC) inhibitor, belonging to the class of natural product metabolites. Its pharmacological effects extend beyond HDAC inhibition, as it is also known to generate intracellular reactive oxygen species (ROS), particularly hydrogen peroxide (H2O2) (PMID:27108737 ). Spiruchostatin B, along with its analog Spiruchostatin A, shows promise for the chemotherapy of leukemia, although the precise mechanisms underlying their effects remain to be fully elucidated (PMID:25078973 ). The identification and characterization of the spiruchostatin biosynthetic gene cluster have facilitated efforts to enhance production yields through the overexpression of transcriptional activators (PMID:24973954 ). Notably, studies have demonstrated that the B cell leukemia cell line NALM-6 exhibits the highest susceptibility to Spiruchostatin B, implicating p21waf1/cip1 expression in the compound's cytotoxic effects on these cells (PMID:22211246 ; PMID:22684370 ). Additionally, the total synthesis of Spiruchostatin B has been achieved using automated synthesizers, marking a significant advancement in the availability of this compound for further research (PMID:21445425 ).
Structure
Synonyms
ValueSource
(1S,7E,9S,13S,14R,19R)-14-Sec-butyl-13-hydroxy-19-methyl-3,4-dithia-15,17,20-triazabicyclo(7.7.6)docos-7-ene-11,16,18,21-tetroneMeSH
Molecular FormulaC21H33N3O6S2
Average Mass487.63
Monoisotopic Mass487.181078143
IUPAC Name(9S,15E,20R)-6-(butan-2-yl)-5,8,18,21-tetrahydroxy-20-methyl-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docosa-7,15,18,21-tetraen-3-one
Traditional Name(9S,15E,20R)-5,8,18,21-tetrahydroxy-20-methyl-6-(sec-butyl)-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docosa-7,15,18,21-tetraen-3-one
CAS Registry NumberNot Available
SMILES
[H]\C1=C([H])\C2([H])CC(O)=N[C@]([H])(C)C(O)=N[C@]([H])(CSSCC1)C(O)=NC([H])(C([H])(C)CC)C([H])(O)CC(=O)O2
InChI Identifier
InChI=1S/C21H33N3O6S2/c1-4-12(2)19-16(25)10-18(27)30-14-7-5-6-8-31-32-11-15(21(29)24-19)23-20(28)13(3)22-17(26)9-14/h5,7,12-16,19,25H,4,6,8-11H2,1-3H3,(H,22,26)(H,23,28)(H,24,29)/b7-5-/t12?,13-,14?,15-,16?,19?/m1/s1
InChI KeyMJHZJODQLYCXHE-JITRVDHBSA-N