Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:34:19 UTC
Update Date2025-10-07 16:06:06 UTC
Metabolite IDMMDBc0013215
Metabolite Identification
Common NameTerrelumamide B
DescriptionTerrelumamide B is a secondary metabolite belonging to the class of amides. It has been identified through molecular dynamics simulations as one of the top-stable metabolites under specific conditions, alongside compounds such as butyrolactone VI and aspulvinone E (PMID:37623885 ). Additionally, terrelumamide B has been highlighted for its potential utility as a diagnostic biomarker for various conditions, specifically in conjunction with other metabolites like Asperpyrone C and Kotanin (PMID:36159648 ). This suggests that terrelumamide B may play a significant role in biological processes and could be relevant in the context of disease diagnosis, although further research is needed to fully elucidate its biological functions and mechanisms of action. The identification of terrelumamide B in these studies underscores its importance in the field of metabolomics and its potential implications in biomedical research.
Structure
SynonymsNot Available
Molecular FormulaC19H18N6O7
Average Mass442.388
Monoisotopic Mass442.123696944
IUPAC Name(2S)-3-hydroxy-2-{[hydroxy(4-hydroxy-1-methyl-2-oxo-1,2-dihydropteridin-6-yl)methylidene]amino}-N-[2-(methoxycarbonyl)phenyl]propanimidic acid
Traditional Name(2S)-3-hydroxy-2-{[hydroxy(4-hydroxy-1-methyl-2-oxopteridin-6-yl)methylidene]amino}-N-[2-(methoxycarbonyl)phenyl]propanimidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](CO)(N=C(O)C1=NC2=C(N=C1)N(C)C(=O)N=C2O)C(O)=NC1=CC=CC=C1C(=O)OC
InChI Identifier
InChI=1S/C19H18N6O7/c1-25-14-13(17(29)24-19(25)31)21-11(7-20-14)15(27)23-12(8-26)16(28)22-10-6-4-3-5-9(10)18(30)32-2/h3-7,12,26H,8H2,1-2H3,(H,22,28)(H,23,27)(H,24,29,31)/t12-/m0/s1
InChI KeyOUIVYIDKZLJROL-LBPRGKRZSA-N