Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:45:15 UTC
Update Date2025-10-07 16:06:08 UTC
Metabolite IDMMDBc0013433
Metabolite Identification
Common NameIsoemericellin
DescriptionIsoemericellin is a prenylxanthone, a class of chemical compounds known for their diverse biological activities and potential therapeutic applications. This metabolite has been isolated from various fungal species, including the marine-derived fungus Emericella variecolor, where it was identified alongside other natural products such as evariquinone. The structural elucidation of isoemericellin was achieved through advanced techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, highlighting its complex chemical nature. Isoemericellin, along with other metabolites from Emericella rugulosa and Emericella variecolor, contributes to the rich chemical diversity of these fungi, which are known to produce a variety of bioactive compounds. The presence of isoemericellin in these fungal extracts suggests potential roles in ecological interactions or applications in pharmacology, although further research is needed to fully understand its biological significance and mechanisms of action (PMID:12770594 ).
Structure
SynonymsNot Available
Molecular FormulaC25H28O5
Average Mass408.494
Monoisotopic Mass408.193674002
IUPAC Name8-hydroxy-1-(hydroxymethyl)-3-methyl-7-(3-methylbut-2-en-1-yl)-2-[(3-methylbut-2-en-1-yl)oxy]-9H-xanthen-9-one
Traditional Nameisoemericellin
CAS Registry NumberNot Available
SMILES
CC(C)=CCOC1=C(C)C=C2OC3=CC=C(CC=C(C)C)C(O)=C3C(=O)C2=C1CO
InChI Identifier
InChI=1S/C25H28O5/c1-14(2)6-7-17-8-9-19-22(23(17)27)24(28)21-18(13-26)25(29-11-10-15(3)4)16(5)12-20(21)30-19/h6,8-10,12,26-27H,7,11,13H2,1-5H3
InChI KeyMDBQNLFOBADTEY-UHFFFAOYSA-N