Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:49:42 UTC
Update Date2025-10-07 16:06:09 UTC
Metabolite IDMMDBc0013536
Metabolite Identification
Common NameN-(3-oxodecanoyl)-L-homoserine lactone
DescriptionN-(3-oxodecanoyl)-L-homoserine lactone is a member of the acyl-homoserine lactone (AHL) chemical class, which plays a crucial role in bacterial quorum sensing—a process that enables bacteria to communicate and coordinate their behavior based on population density. This metabolite, specifically designated as 3-oxo-C10-HSL, is produced by various marine microorganisms, including those from the genus Ponticoccus (PMID:38637055 ). It has been identified alongside other AHLs in different bacterial species, highlighting its prevalence in microbial communication systems (PMID:35010421 ). N-(3-oxodecanoyl)-L-homoserine lactone has also been shown to interact with membranes due to its surface-active properties, suggesting a significant role in modulating bacterial behavior and biofilm formation (PMID:21736305 ). Furthermore, its degradation by certain bacteria indicates its involvement in ecological interactions within marine environments (PMID:25006994 ). The characterization of this compound in various strains emphasizes its importance in understanding bacterial signaling and its potential applications in biotechnology and environmental science (PMID:28087611 ; PMID:26729121 ; PMID:22736981 ).
Structure
Synonyms
ValueSource
Mini-proinsulinMeSH
MiniproinsulinMeSH
Molecular FormulaC14H23NO4
Average Mass269.341
Monoisotopic Mass269.162708225
IUPAC NameNot Available
Traditional NameNot Available
CAS Registry NumberNot Available
SMILESNot Available
InChI Identifier
InChI=1S/C14H23NO4/c1-2-3-4-5-6-7-11(16)10-13(17)15-12-8-9-19-14(12)18/h12H,2-10H2,1H3,(H,15,17)/t12-/m0/s1
InChI KeyKYGIKEQVUKTKRR-LBPRGKRZSA-N