Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:52:15 UTC
Update Date2025-10-07 16:06:10 UTC
Metabolite IDMMDBc0013595
Metabolite Identification
Common NameAflatrem
DescriptionAflatrem is a secondary metabolite belonging to the chemical class of indole diterpenes, primarily produced by certain species of the fungus Aspergillus. It has garnered attention due to its presence alongside other mycotoxins, such as aflatoxins and cyclopiazonic acid, in various substrates, including agricultural products. Studies have shown that pulses can accumulate significant levels of aflatrem, which raises concerns regarding its potential toxicological effects (PMID:40510667 ). Moreover, genetic analyses have revealed that aflatrem biosynthesis is regulated by specific gene clusters, indicating its complex biosynthetic pathways in fungi (PMID:39227280 ). Aflatrem's role in food safety is underscored by its association with other mycotoxins that can adversely affect human health (PMID:34408970 ). Additionally, research suggests that aflatrem may influence behavior in ants, potentially disrupting feeding patterns through its effects on neurobiology (PMID:32354705 ). The regulation of aflatrem production by various genetic factors highlights its significance in the broader context of fungal secondary metabolism (PMID:30635379 ). Overall, aflatrem's biochemical properties and biological implications warrant further investigation to understand its impact on health and safety.
Structure
SynonymsNot Available
Molecular FormulaC32H39NO4
Average Mass501.667
Monoisotopic Mass501.28790874
IUPAC Name(1S,4R,5S,16S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-12-(2-methylbut-3-en-2-yl)-25,26-dioxa-7-azaheptacyclo[21.2.1.0^{1,20}.0^{4,19}.0^{5,16}.0^{6,14}.0^{8,13}]hexacosa-6(14),8,10,12,20-pentaen-22-one
Traditional Name(1S,4R,5S,16S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-12-(2-methylbut-3-en-2-yl)-25,26-dioxa-7-azaheptacyclo[21.2.1.0^{1,20}.0^{4,19}.0^{5,16}.0^{6,14}.0^{8,13}]hexacosa-6(14),8,10,12,20-pentaen-22-one
CAS Registry NumberNot Available
SMILES
[H][C@]12CC3=C(NC4=CC=CC(=C34)C(C)(C)C=C)[C@]1(C)[C@@]1(C)CC[C@@]34O[C@@]([H])(C(=O)C=C3[C@]1(O)CC2)C(C)(C)O4
InChI Identifier
InChI=1S/C32H39NO4/c1-8-27(2,3)20-10-9-11-21-24(20)19-16-18-12-13-31(35)23-17-22(34)26-28(4,5)37-32(23,36-26)15-14-29(31,6)30(18,7)25(19)33-21/h8-11,17-18,26,33,35H,1,12-16H2,2-7H3/t18-,26-,29+,30+,31+,32-/m0/s1
InChI KeyYVDJBQQJIDPRKP-SLUQHKSNSA-N