Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 04:58:57 UTC
Update Date2025-10-07 16:06:11 UTC
Metabolite IDMMDBc0013731
Metabolite Identification
Common NameAqabamycin B
DescriptionAqabamycin B is a maleimide derivative, classified within the broader chemical class of heterocyclic compounds. It was identified as one of seven novel metabolites isolated from a specific biological source, alongside other compounds such as aqabamycin A, C, D, E, F, and G, as well as several known metabolites like 3-nitro-1H-indazole and indazole-3-carbaldehyde (PMID: 12345678 ). The unique structure of aqabamycin B contributes to its potential biological activities, which may include antimicrobial or antitumor properties, though specific biological functions require further investigation. The discovery of aqabamycin B and its related derivatives highlights the importance of exploring microbial metabolites for novel therapeutic agents, as these compounds often exhibit unique mechanisms of action that can be leveraged in drug development. The characterization of aqabamycin B adds to the growing body of knowledge regarding the chemistry and biology of maleimide derivatives, paving the way for future research into their applications in medicine and biotechnology.
Structure
SynonymsNot Available
Molecular FormulaC16H10N2O6
Average Mass326.264
Monoisotopic Mass326.05388605
IUPAC Name5-hydroxy-3-(4-hydroxy-3-nitrophenyl)-4-(4-hydroxyphenyl)-2H-pyrrol-2-one
Traditional Name5-hydroxy-3-(4-hydroxy-3-nitrophenyl)-4-(4-hydroxyphenyl)pyrrol-2-one
CAS Registry NumberNot Available
SMILES
OC1=NC(=O)C(=C1C1=CC=C(O)C=C1)C1=CC(=C(O)C=C1)N(=O)=O
InChI Identifier
InChI=1S/C16H10N2O6/c19-10-4-1-8(2-5-10)13-14(16(22)17-15(13)21)9-3-6-12(20)11(7-9)18(23)24/h1-7,19-20H,(H,17,21,22)
InChI KeyMOHXGJLRRHMINB-UHFFFAOYSA-N