Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:04:38 UTC
Update Date2025-10-07 16:06:12 UTC
Metabolite IDMMDBc0013878
Metabolite Identification
Common NameAlantryphenone
DescriptionAlantryphenone is a metabolite classified within the chemical class of phenones, which are characterized by the presence of a carbonyl group bonded to an aromatic ring. This compound has garnered attention in the field of organic chemistry due to its structural complexity and potential biological activities. The synthesis of alantryphenone has been explored alongside other significant compounds, highlighting its relevance in the development of novel pharmaceuticals. For instance, a study focused on the total syntheses of (±)-spiroquinazoline, (-)-alantryphenone, (+)-lapatin A, and (-)-quinadoline B demonstrates its synthetic accessibility and importance in medicinal chemistry (PMID:23868659 ). While specific biological functions of alantryphenone remain to be fully elucidated, its classification as a metabolite suggests potential roles in metabolic pathways and interactions with biological systems. Further research could reveal insights into its pharmacological properties and applications in drug development, making it a compound of interest for both chemists and biologists alike.
Structure
SynonymsNot Available
Molecular FormulaC30H25N5O3
Average Mass503.562
Monoisotopic Mass503.195739685
IUPAC Name(1'R,2R,9R,9aS,12'R)-2-benzyl-15'-hydroxy-12'-methyl-1,2,3,9a-tetrahydro-2',10',16'-triazaspiro[imidazo[1,2-a]indole-9,13'-tetracyclo[10.2.2.0^{2,11}.0^{4,9}]hexadecane]-4',6',8',10',15'-pentaene-3,3'-dione
Traditional Name(1'R,2R,9R,9aS,12'R)-2-benzyl-15'-hydroxy-12'-methyl-2,9a-dihydro-1H-2',10',16'-triazaspiro[imidazo[1,2-a]indole-9,13'-tetracyclo[10.2.2.0^{2,11}.0^{4,9}]hexadecane]-4',6',8',10',15'-pentaene-3,3'-dione
CAS Registry NumberNot Available
SMILES
[H][C@]1(CC2=CC=CC=C2)N[C@@]2([H])N(C1=O)C1=CC=CC=C1[C@@]21C[C@@]2([H])N3C(=O)C4=CC=CC=C4N=C3[C@]1(C)N=C2O
InChI Identifier
InChI=1S/C30H25N5O3/c1-29-27-31-20-13-7-5-11-18(20)25(37)35(27)23(24(36)33-29)16-30(29)19-12-6-8-14-22(19)34-26(38)21(32-28(30)34)15-17-9-3-2-4-10-17/h2-14,21,23,28,32H,15-16H2,1H3,(H,33,36)/t21-,23-,28+,29+,30+/m1/s1
InChI KeyXGALXCIYIXMPKV-FUYNQFFVSA-N