Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:08:52 UTC
Update Date2025-10-07 16:06:13 UTC
Metabolite IDMMDBc0013982
Metabolite Identification
Common NamePyranonigrin E
DescriptionPyranonigrin E is a polyketide-nonribosomal peptide synthase (PKS-NRPS) hybrid metabolite derived from the fungus Aspergillus niger. It is part of a broader class of secondary metabolites produced by various Penicillium and Aspergillus species, which are known for their diverse biosynthetic gene clusters (BGCs). Genome mining has revealed that pyranonigrin E is encoded within conserved BGCs, indicating its significance in the metabolic pathways of these fungi (PMID:34947073 ). Studies have identified pyranonigrin E alongside other metabolites such as clavaric acid and dimethyl coprogen, suggesting a complex interplay of biosynthetic capabilities among fungal strains (PMID:37208988 ). The isolation of pyranonigrin E has prompted further biosynthetic investigations, particularly in relation to its structural analogs, which may exhibit various biological activities (PMID:24084681 ). Additionally, the identification of pyranonigrin E through genome mining highlights its potential relevance in the study of fungal metabolites and their applications in biotechnology and pharmacology (PMID:24106156 ). Overall, pyranonigrin E exemplifies the intricate chemistry of fungal secondary metabolites and their potential utility in various fields.
Structure
SynonymsNot Available
Molecular FormulaC18H21NO4
Average Mass315.369
Monoisotopic Mass315.14705816
IUPAC Name3-hydroxy-6-methyl-7-methylidene-2-[(1E,3E)-nona-1,3-dien-1-yl]-4H,5H,6H,7H-pyrano[2,3-c]pyrrole-4,5-dione
Traditional Name3-hydroxy-6-methyl-7-methylidene-2-[(1E,3E)-nona-1,3-dien-1-yl]pyrano[2,3-c]pyrrole-4,5-dione
CAS Registry NumberNot Available
SMILES
[H]\C(CCCCC)=C(\[H])/C(/[H])=C(\[H])C1=C(O)C(=O)C2=C(O1)C(=C)N(C)C2=O
InChI Identifier
InChI=1S/C18H21NO4/c1-4-5-6-7-8-9-10-11-13-15(20)16(21)14-17(23-13)12(2)19(3)18(14)22/h8-11,20H,2,4-7H2,1,3H3/b9-8+,11-10+
InChI KeyITJJIMKGOLMIJY-BNFZFUHLSA-N