Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:13:49 UTC
Update Date2025-10-07 16:04:15 UTC
Metabolite IDMMDBc0014085
Metabolite Identification
Common NamePneumocandin B0
DescriptionPneumocandin B0 is a lipopeptide synthesized by the fungus Glarea lozoyensis and serves as a precursor for the antifungal drug caspofungin acetate (Cancidas®) (PMID:39830076 ). This compound features a complex chemical structure characterized by a hexapeptide backbone linked to a lipid moiety, which is crucial for its biological activity. In the biosynthetic pathway, pneumocandin B0 is produced through the incorporation of fatty acids, with studies showing that the addition of stearic and acetic acids can enhance its production by 22.98% and 9.08%, respectively (PMID:38647938 ). The presence of these fatty acids also promotes lipid accumulation and the formation of intracellular lipid droplets, which help sequester pneumocandin B0 and mitigate cell damage (PMID:38647938 ). This lipopeptide is not only significant as a precursor for caspofungin but is also involved in various metabolic pathways that enhance its biosynthesis, providing insights into potential metabolic engineering strategies to improve yields (PMID:38647938 ). Additionally, pneumocandin B0 is related to other echinocandins, which are clinically available and effective in managing invasive fungal infections (PMID:37885073 ).
Structure
Synonyms
ValueSource
Pneumocandin b(0)MeSH
Pneumocardin b(0)MeSH
Molecular FormulaC50H80N8O17
Average Mass1065.229
Monoisotopic Mass1064.564143148
IUPAC Name(10R,12S)-N-[(3S,6S,9S,11R,15S,18R,20R,21R,24S,25S)-6-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-5,8,11,17,20,21,23,25-octahydroxy-3-[(1R)-1-hydroxy-2-(C-hydroxycarbonimidoyl)ethyl]-15-[(1R)-1-hydroxyethyl]-2,14-dioxo-1,4,7,13,16,22-hexaazatricyclo[22.3.0.0^{9,13}]heptacosa-4,7,16,22-tetraen-18-yl]-10,12-dimethyltetradecanimidic acid
Traditional Name(10R,12S)-N-[(3S,6S,9S,11R,15S,18R,20R,21R,24S,25S)-6-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-5,8,11,17,20,21,23,25-octahydroxy-3-[(1R)-1-hydroxy-2-(C-hydroxycarbonimidoyl)ethyl]-15-[(1R)-1-hydroxyethyl]-2,14-dioxo-1,4,7,13,16,22-hexaazatricyclo[22.3.0.0^{9,13}]heptacosa-4,7,16,22-tetraen-18-yl]-10,12-dimethyltetradecanimidic acid
CAS Registry NumberNot Available
SMILES
[H][C@](C)(CC)C[C@]([H])(C)CCCCCCCCC(O)=N[C@]1([H])C[C@@]([H])(O)[C@@]([H])(O)N=C(O)[C@@]2([H])N(CC[C@]2([H])O)C(=O)[C@@]([H])(N=C(O)[C@@]([H])(N=C(O)[C@]2([H])C[C@@]([H])(O)CN2C(=O)[C@@]([H])(N=C1O)[C@@]([H])(C)O)[C@]([H])(O)[C@@]([H])(O)C1=CC=C(O)C=C1)[C@]([H])(O)CC(O)=N
InChI Identifier
InChI=1S/C50H80N8O17/c1-5-25(2)20-26(3)12-10-8-6-7-9-11-13-37(66)52-31-22-35(64)46(71)56-48(73)41-33(62)18-19-57(41)50(75)39(34(63)23-36(51)65)54-47(72)40(43(68)42(67)28-14-16-29(60)17-15-28)55-45(70)32-21-30(61)24-58(32)49(74)38(27(4)59)53-44(31)69/h14-17,25-27,30-35,38-43,46,59-64,67-68,71H,5-13,18-24H2,1-4H3,(H2,51,65)(H,52,66)(H,53,69)(H,54,72)(H,55,70)(H,56,73)/t25-,26+,27+,30+,31+,32-,33-,34+,35+,38-,39-,40-,41-,42-,43-,46+/m0/s1
InChI KeyDQXPFAADCTZLNL-HDLADETGSA-N