Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:22:17 UTC
Update Date2025-10-07 16:06:15 UTC
Metabolite IDMMDBc0014301
Metabolite Identification
Common NameAsperazine
DescriptionAsperazine is a diketopiperazine, a class of cyclic dipeptides characterized by their unique structure and diverse biological activities. This metabolite has been isolated from various fungal species, including the endophytic fungus Aspergillus fumigatus, where it was found alongside other alkaloids such as pyranonigrin A and pestalazine compounds (PMID:37874626 ). Asperazine has garnered attention for its potential applications in synthetic chemistry, particularly in the development of analogs through stereoselective domino dimerization processes (PMID:36861828 ). The compound has also been studied for its biological effects, exhibiting weak attractant activity on silkworms (PMID:34786852 ). Furthermore, certain vinaceus strains of fungi were noted to produce asperazine while lacking the ability to generate ochratoxin A and fumonisins, suggesting a potential for safer bioproduction (PMID:33348541 ). Chemical investigations of fermented cultures have confirmed its presence among other compounds, highlighting its significance in the metabolic profiles of various fungi (PMID:35744888 ). Overall, asperazine represents an intriguing subject for further exploration in both chemical synthesis and biological research.
Structure
SynonymsNot Available
Molecular FormulaC40H36N6O4
Average Mass664.766
Monoisotopic Mass664.279803663
IUPAC Name(1R,4R,7S,9R)-4-benzyl-9-(3-{[(2S,5R)-5-benzyl-3,6-dihydroxy-2,5-dihydropyrazin-2-yl]methyl}-1H-indol-7-yl)-6-hydroxy-2,5,16-triazatetracyclo[7.7.0.0^{2,7}.0^{10,15}]hexadeca-5,10,12,14-tetraen-3-one
Traditional Name(1R,4R,7S,9R)-4-benzyl-9-(3-{[(2S,5R)-5-benzyl-3,6-dihydroxy-2,5-dihydropyrazin-2-yl]methyl}-1H-indol-7-yl)-6-hydroxy-2,5,16-triazatetracyclo[7.7.0.0^{2,7}.0^{10,15}]hexadeca-5,10,12,14-tetraen-3-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12C[C@@]3(C4=CC=CC=C4N[C@]3([H])N1C(=O)[C@@]([H])(CC1=CC=CC=C1)N=C2O)C1=CC=CC2=C1NC=C2C[C@]1([H])N=C(O)[C@@]([H])(CC2=CC=CC=C2)N=C1O
InChI Identifier
InChI=1S/C40H36N6O4/c47-35-30(18-23-10-3-1-4-11-23)42-36(48)31(43-35)20-25-22-41-34-26(25)14-9-16-28(34)40-21-33-37(49)44-32(19-24-12-5-2-6-13-24)38(50)46(33)39(40)45-29-17-8-7-15-27(29)40/h1-17,22,30-33,39,41,45H,18-21H2,(H,42,48)(H,43,47)(H,44,49)/t30-,31+,32-,33+,39-,40-/m1/s1
InChI KeyAWMBNXCUMNOLQI-JQLKQZRRSA-N