Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:41:19 UTC
Update Date2025-10-07 16:06:18 UTC
Metabolite IDMMDBc0014701
Metabolite Identification
Common NameDeoxynortryptoquivaline
DescriptionDeoxynortryptoquivaline is a metabolite belonging to the class of alkaloids, specifically a derivative of tryptoquivaline. This compound was isolated from the marine ascidian-derived fungus Aspergillus clavatus, where its absolute configuration was determined through anisotropic NMR and chiroptical spectroscopy (PMID:38289330 ). Deoxynortryptoquivaline has garnered attention for its biological activity, particularly as a novel inhibitor of androgen receptor (AR) function, positioning it as a unique antiprostate cancer agent (PMID:37744273 ). In silico assessments have indicated that deoxynortryptoquivaline exhibits significant binding energy with multiple target proteins, suggesting its potential as a bioactive compound in pharmacological applications (PMID:35355337 ). Furthermore, studies have shown that the concentrations of deoxynortryptoquivaline, along with other related metabolites, are notably higher than those of other mycotoxins, indicating its prominence in the metabolic profile of certain fungal species (PMID:29236246 ). Overall, deoxynortryptoquivaline represents a fascinating subject of study within the fields of chemistry and biology due to its structural uniqueness and potential therapeutic applications.
Structure
Synonyms
ValueSource
2-Methyl-1-(3-{2-methyl-3,5'-dioxo-1,2,3,9a-tetrahydrospiro[imidazo[1,2-a]indole-9,2'-oxolane]-4'-yl}-4-oxo-3,4-dihydroquinazolin-2-yl)propyl acetic acidGenerator
Molecular FormulaC28H28N4O6
Average Mass516.554
Monoisotopic Mass516.200884638
IUPAC Name2-methyl-1-(3-{2-methyl-3,5'-dioxo-1,2,3,9a-tetrahydrospiro[imidazolidino[1,2-a]indole-9,2'-oxolane]-4'-yl}-4-oxo-3,4-dihydroquinazolin-2-yl)propyl acetate
Traditional Name2-methyl-1-(3-{2-methyl-3,5'-dioxo-2,9a-dihydro-1H-spiro[imidazolidino[1,2-a]indole-9,2'-oxolane]-4'-yl}-4-oxoquinazolin-2-yl)propyl acetate
CAS Registry NumberNot Available
SMILES
CC(C)C(OC(C)=O)C1=NC2=CC=CC=C2C(=O)N1C1CC2(OC1=O)C1NC(C)C(=O)N1C1=CC=CC=C21
InChI Identifier
InChI=1S/C28H28N4O6/c1-14(2)22(37-16(4)33)23-30-19-11-7-5-9-17(19)25(35)31(23)21-13-28(38-26(21)36)18-10-6-8-12-20(18)32-24(34)15(3)29-27(28)32/h5-12,14-15,21-22,27,29H,13H2,1-4H3
InChI KeyUQWRSTHNSHDTCA-UHFFFAOYSA-N