Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:44:04 UTC
Update Date2025-10-07 16:06:19 UTC
Metabolite IDMMDBc0014761
Metabolite Identification
Common NameAsporyzin B
DescriptionAsporyzin B is a novel indoloditerpene derivative, a chemical class characterized by its complex structure that incorporates both indole and diterpene components. It was isolated from the endophytic fungus Aspergillus oryzae, which was derived from the marine red alga Heterosiphonia japonica. This discovery highlights the potential of marine-derived fungi as a source of unique bioactive compounds. Indoloditerpenes, including Asporyzin B, are of significant interest due to their diverse biological activities, which may include antimicrobial and anticancer properties, although specific biological functions of Asporyzin B remain to be fully elucidated. The isolation of Asporyzin B, along with other related compounds such as asporyzin A and C, underscores the rich chemical diversity present in marine ecosystems and the potential for discovering new therapeutic agents from natural sources (PMID:20797856 ).
Structure
SynonymsNot Available
Molecular FormulaC28H37NO3
Average Mass435.608
Monoisotopic Mass435.277344055
IUPAC Name(1S,2S,5S,7R,9S,10R,13S)-15-hydroxy-1,2,9-trimethyl-7-(2-methylprop-1-en-1-yl)-6-oxa-22-azahexacyclo[11.10.0.0^{2,10}.0^{5,9}.0^{15,22}.0^{16,21}]tricosa-16,18,20-trien-23-one
Traditional Name(1S,2S,5S,7R,9S,10R,13S)-15-hydroxy-1,2,9-trimethyl-7-(2-methylprop-1-en-1-yl)-6-oxa-22-azahexacyclo[11.10.0.0^{2,10}.0^{5,9}.0^{15,22}.0^{16,21}]tricosa-16,18,20-trien-23-one
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C[C@]2(C)[C@]([H])(CC[C@@]3(C)[C@@]2([H])CC[C@@]2([H])CC4(O)N(C5=CC=CC=C45)C(=O)[C@]32C)O1)C=C(C)C
InChI Identifier
InChI=1S/C28H37NO3/c1-17(2)14-19-16-25(3)22-11-10-18-15-28(31)20-8-6-7-9-21(20)29(28)24(30)27(18,5)26(22,4)13-12-23(25)32-19/h6-9,14,18-19,22-23,31H,10-13,15-16H2,1-5H3/t18-,19-,22-,23-,25-,26-,27+,28?/m0/s1
InChI KeySPCHXPAJDYUPBJ-QFRRQRMOSA-N