Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:45:19 UTC
Update Date2025-10-07 16:06:19 UTC
Metabolite IDMMDBc0014793
Metabolite Identification
Common NameMetagenetriindole A
DescriptionMetagenetriindole A is a novel indole alkaloid identified from deep-sea sediment metagenomic clone-derived Escherichia coli fermentation broth. This compound belongs to the chemical class of indole alkaloids, which are known for their diverse biological activities and complex structures. The discovery of metagenetriindole A highlights the potential of metagenomics in uncovering unique metabolites from unexplored environments, such as deep-sea ecosystems. Indole alkaloids often exhibit various pharmacological properties, including antimicrobial and anticancer activities, making them of significant interest in medicinal chemistry. The identification of metagenetriindole A, alongside another compound, metagenebiindole A, emphasizes the rich chemical diversity that can be accessed through the study of microbial metabolites in extreme habitats. The research surrounding these compounds may pave the way for the development of new therapeutic agents derived from marine microorganisms, showcasing the importance of bioprospecting in drug discovery. (PMID:24717525 )
Structure
SynonymsNot Available
Molecular FormulaC26H19N3O
Average Mass389.458
Monoisotopic Mass389.152812244
IUPAC Name1,2,2-tris(1H-indol-3-yl)ethan-1-one
Traditional Name1,2,2-tris(1H-indol-3-yl)ethanone
CAS Registry NumberNot Available
SMILES
O=C(C(C1=CNC2=CC=CC=C12)C1=CNC2=CC=CC=C12)C1=CNC2=CC=CC=C12
InChI Identifier
InChI=1S/C26H19N3O/c30-26(21-15-29-24-12-6-3-9-18(21)24)25(19-13-27-22-10-4-1-7-16(19)22)20-14-28-23-11-5-2-8-17(20)23/h1-15,25,27-29H
InChI KeyVKPHFVAPGSILPE-UHFFFAOYSA-N