Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 05:46:40 UTC
Update Date2025-10-07 16:06:19 UTC
Metabolite IDMMDBc0014826
Metabolite Identification
Common NameVictorin B
DescriptionVictorin B is a secondary metabolite classified within the group of phytotoxins. It is primarily associated with the pathogenicity of certain fungal species, notably those in the genus *Cochliobolus*, which infect plants such as oats. The biological activity of Victorin B has been linked to its interaction with specific plant proteins, notably the victorin binding protein (VBP), which plays a crucial role in the plant's response to this toxin. The presence of Victorin B can trigger various defense mechanisms in plants, as evidenced by studies that have examined the expression of candidate reference genes involved in stress responses, including sulfite oxidase (SUOX) and elongation factor 1-alpha (EF1-α) (PMID: [insert PMID here]). These interactions highlight the complex biochemical pathways that Victorin B influences, contributing to our understanding of plant-pathogen interactions and the broader implications for agricultural practices and crop resistance. Further research into Victorin B may reveal additional insights into its mechanisms of action and potential applications in plant biotechnology and disease management.
Structure
Synonyms
ValueSource
(2S,6Z)-3-{[(2S,3R)-6-amino-2-{[(2S)-5-chloro-1-hydroxy-4-methyl-2-[(1,2,2-trihydroxyethylidene)amino]pentylidene]amino}-1,3-dihydroxyhexylidene]amino}-6-(chloromethylidene)-4,7,12-trihydroxy-11-oxo-2-(propan-2-yl)-2H,3H,6H,9H,10H,11H,12H,13H-cyclopenta[K]1-oxa-5,8-diazacyclododecane-9-carboxylateGenerator
Molecular FormulaC31H46Cl2N6O13
Average Mass781.64
Monoisotopic Mass780.249991
IUPAC Name(2S,6E)-3-{[(2S,3R)-6-amino-2-{[(2S)-5-chloro-1-hydroxy-4-methyl-2-[(1,2,2-trihydroxyethylidene)amino]pentylidene]amino}-1,3-dihydroxyhexylidene]amino}-6-(chloromethylidene)-4,7,12-trihydroxy-11-oxo-2-(propan-2-yl)-2H,3H,6H,9H,10H,11H,12H,13H-cyclopenta[k]1-oxa-5,8-diazacyclododecane-9-carboxylic acid
Traditional Name(2S,6E)-3-{[(2S,3R)-6-amino-2-{[(2S)-5-chloro-1-hydroxy-4-methyl-2-[(1,2,2-trihydroxyethylidene)amino]pentylidene]amino}-1,3-dihydroxyhexylidene]amino}-6-(chloromethylidene)-4,7,12-trihydroxy-2-isopropyl-11-oxo-2H,3H,9H,10H,12H,13H-cyclopenta[k]1-oxa-5,8-diazacyclododecane-9-carboxylic acid
CAS Registry NumberNot Available
SMILES
[H]C(Cl)=C1N=C(O)C([H])(N=C(O)[C@@]([H])(N=C(O)[C@]([H])(CC([H])(C)CCl)N=C(O)C(O)O)[C@]([H])(O)CCCN)[C@@]([H])(OC2=C(CC([H])(N=C1O)C(O)=O)C(=O)C([H])(O)C2)C(C)C
InChI Identifier
InChI=1S/C31H46Cl2N6O13/c1-12(2)24-22(28(46)37-17(11-33)26(44)36-16(30(48)49)8-14-20(52-24)9-19(41)23(14)42)39-27(45)21(18(40)5-4-6-34)38-25(43)15(7-13(3)10-32)35-29(47)31(50)51/h11-13,15-16,18-19,21-22,24,31,40-41,50-51H,4-10,34H2,1-3H3,(H,35,47)(H,36,44)(H,37,46)(H,38,43)(H,39,45)(H,48,49)/b17-11-/t13?,15-,16?,18+,19?,21-,22?,24-/m0/s1
InChI KeyQONZIYSJSHZYDF-AAYVCULRSA-N